Uvitonic acid

{{Chembox

| ImageFile = Uvitonic acid.svg

| ImageSize = 200px

| ImageAlt =

| PIN = 6-Methylpyridine-2,4-dicarboxylic acid

| OtherNames = {{bulletedlist|6-Methyl-pyridine-2,4-dicarboxylic acid | 6-Methylcinchomeronic acid | 6-Methyl-2,4-pyridinedicarboxylic acid}}

| Section1 = {{Chembox Identifiers

| CASNo = 499-50-3

| CASNo_Ref = {{Cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = X7MQU282AW

| PubChem = 12059143

| ChemSpiderID = 14208829

| EINECS =

| SMILES = CC1=NC=C(C(O)=O)C(=C1)C(O)=O

| StdInChI=1S/C8H7NO4/c1-4-2-5(7(10)11)3-6(9-4)8(12)13/h2-3H,1H3,(H,10,11)(H,12,13)

| StdInChIKey= KPJDOBLKTXEADO-UHFFFAOYSA-N

}}

| Section2 = {{Chembox Properties

| C=8|H=7|N=1|O=4

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| MolarMass = 181.145480 g/mol

| VaporPressure =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| GHSPictograms =

| GHSSignalWord =

| HPhrases =

| PPhrases =

| FlashPt =

| AutoignitionPt =

}}

}}

Uvitonic acid (6-methyl-2,4-pyridinedicarboxylic acid) is an organic compound with the formula CH₃C₅H₂N(COOH)₂.{{cite book |title=Bulletin |date=1912 |publisher=U.S. Government Printing Office |page=66 |url=https://www.google.ru/books/edition/Bulletin/o3bwAAAAMAAJ?hl=en&gbpv=1&dq=Uvitonic+acid&pg=RA3-PA66&printsec=frontcover |access-date=5 April 2025 |language=en}} The acid is a pyridine analogue of the benzene derivative uvitic acid.{{cite book|last1=Senning|first1=Alexander|title=Elsevier's Dictionary of Chemoetymology: The Whys and Whences of Chemical Nomenclature and Terminology|date=2006|publisher=Elsevier|isbn=9780080488813|pages=410|url=https://books.google.com/books?id=Fl4sdCYrq3cC&q=uvitic+acid+--+uva+a+grape&pg=PA410|accessdate=31 October 2016}}

Under normal conditions, the acid is a white crystalline substance.{{cite web|title=Uvitonic acid|url=https://en.wiktionary.org/wiki/uvitonic_acid|publisher=wiktionary.org|accessdate=22 November 2016}}{{Better source needed|reason=Wiktionary is not a reliable source, as it can be freely edited.|date=December 2022}}