Vaccenyl acetate

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 428729258

| Name=11-cis-Vaccenyl acetate

| ImageFile=vaccenyl acetate.png

| ImageSize=200px

| PIN=(11Z)-Octadec-11-en-1-yl acetate

| OtherNames=

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=6186-98-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 49M29ZH9TS

| PubChem=5363286

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4515653

| SMILES = CCCCCC/C=C\CCCCCCCCCCOC(=O)C

| InChI = 1/C20H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20(2)21/h8-9H,3-7,10-19H2,1-2H3/b9-8-

| InChIKey = QSZKEDWVAOAFQY-HJWRWDBZBI

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C20H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20(2)21/h8-9H,3-7,10-19H2,1-2H3/b9-8-

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = QSZKEDWVAOAFQY-HJWRWDBZSA-N

| RTECS =

| MeSHName =

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 46274

}}

|Section2={{Chembox Properties

| Formula=C₂₀H₃₈O₂

| MolarMass=310.51 g/mol

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

| Section9 = {{Chembox Related

|OtherCompounds = cis-vaccenic acid

}}

}}

11-cis-Vaccenyl acetate (cVA) is a volatile chemical compound that acts as a pheromone in Drosophila and at least one species of longhorn beetle. It is the acetate ester of vaccenyl alcohol.

The odorant receptor subunit Or67d was shown to be necessary for detection of cVA.Ha, TS, Smith DP J. Neurosci. 26:8727-8733 (2006). Males that are mutant for Or67d start courting other males, whereas females that lack Or67d become less receptive towards males courting them.A. Kurtovic, A. Widmer, B. J. Dickson, Nature 446, 542 (2007). The sensory neurons expressing Or67d send projections to the glomerulus DA1.Couto A, Alenius M, Dickson BJ.; Curr Biol. 2005 Sep 6;15(17):1535-47. DA1 is one of the three glomeruli that is bigger in males than in females. Moreover, the projection neurons that connect to DA1 have sexually dimorphic arborizations in the higher brain centers (esp. lateral horn).