Valnemulin

{{Short description|Chemical compound}}

{{Use dmy dates|date=December 2024}}

{{cs1 config |name-list-style=vanc |display-authors=6}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 470628046

| image = Valnemulin.svg

| width = 300

| alt =

| tradename = Econor, others

| Drugs.com = {{drugs.com|international|valnemulin}}

| pregnancy_AU =

| pregnancy_category =

| routes_of_administration = By mouth (in-feed)

| ATCvet = yes

| ATC_prefix = J01

| ATC_suffix = XQ02

| ATC_supplemental =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_EU = Rx-only

| legal_EU_comment = {{cite web | title=Econor EPAR | website=European Medicines Agency (EMA) | date=12 March 1999 | url=https://www.ema.europa.eu/en/medicines/veterinary/EPAR/econor | access-date=26 December 2024}}{{cite web | title=Econor PI | website=Union Register of medicinal products | date=16 March 1999 | url=https://ec.europa.eu/health/documents/community-register/html/v010.htm | access-date=26 December 2024}}

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 101312-92-9

| PubChem = 127791

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 8026591

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2AHC415BQG

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1688852

| IUPAC_name = (3aS,4R,5S,6S,8R,9R,9aR,10R)-6-ethenyl-
5-hydroxy-4,6,9,10-tetramethyl-1-oxodecahydro-
3a,9-propano-3aH-cyclopenta[8]annulen-8-yl-
[(R)-2-(2-amino-3-methylbutanoylamino)-1,1-dimethtylethyl
sulfanyl]acetate

| C=31 | H=52 | N=2 | O=5 | S=1

| smiles = O=C(NCC(SCC(=O)O[C@@H]2C[C@@](\C=C)([C@@H](O)[C@@H]([C@]31[C@@H](C(=O)CC1)[C@@]2(C)[C@H](C)CC3)C)C)(C)C)[C@H](N)C(C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C31H52N2O5S/c1-10-29(8)15-22(38-23(35)16-39-28(6,7)17-33-27(37)24(32)18(2)3)30(9)19(4)11-13-31(20(5)26(29)36)14-12-21(34)25(30)31/h10,18-20,22,24-26,36H,1,11-17,32H2,2-9H3,(H,33,37)/t19-,20+,22-,24-,25+,26+,29-,30+,31+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = LLYYNOVSVPBRGV-MVNKZKPCSA-N

}}

Valnemulin, sold under the brand name Econor among others, is a pleuromutilin antibiotic used to treat swine dysentery, ileitis, colitis, and pneumonia. It is also used for the prevention of intestinal infections of swine.[http://www.emea.europa.eu/vetdocs/PDFs/EPAR/econor/003199en6.pdf Econor: Product Profile] Valnemulin has been observed to induce a rapid reduction of clinical symptoms of Mycoplasma bovis infection, and eliminate M. bovis from the lungs of calves.{{cite journal | vauthors = Stipkovits L, Ripley PH, Tenk M, Glávits R, Molnár T, Fodor L | title = The efficacy of valnemulin (Econor) in the control of disease caused by experimental infection of calves with Mycoplasma bovis | journal = Research in Veterinary Science | volume = 78 | issue = 3 | pages = 207–15 | date = June 2005 | pmid = 15766939 | doi = 10.1016/j.rvsc.2004.09.005 }}{{Cite web|url=https://cimavet.aemps.es/cimavet/publico/detalle.html?nregistro=3888%20ESP|title = .:: CIMAVet ::. Detalle del medicamento}}

References