Vapreotide

{{Short description|Pharmaceutical drug}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| IUPAC_name = D-phenylalanyl-L-cysteinyl-L-tyrosyl-D-tryptophyl-L-lysyl-L-valyl-L-cysteinyl-L-tryptophanamide (2->7)-disulfide

| synonyms = H-D-Phe-Cys(1)-Tyr-D-Trp-Lys-Val-Cys(1)-Trp-NH2
Octastatin

| image = Vapreotide.svg

| width =

| alt =

| image2 =

| width2 =

| drug_name =

| caption =

| tradename = Sanvar

| licence_EU =

| licence_US =

| DailyMedID =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| dependency_liability =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life = 30 minutes

| excretion =

| CAS_number = 103222-11-3

| CAS_supplemental =

| ATCvet =

| ATC_prefix = H01

| ATC_suffix = CB04

| ATC_supplemental =

| UNII = 2PK59M9GFF

| PubChem = 23725064

| PubChemSubstance = 46506923

| IUPHAR_ligand =

| DrugBank = DB04894

| ChemSpiderID = 64425

| KEGG = D06281

| C=57 | H=70 | N=12 | O=9 | S=2

| SMILES = CC(C)[C@H]1C(=O)N[C@@H](CSSC[C@@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N1)CCCCN)Cc2c[nH]c3c2cccc3)Cc4ccc(cc4)O)NC(=O)[C@@H](Cc5ccccc5)N)C(=O)N[C@@H](Cc6c[nH]c7c6cccc7)C(=O)N

| StdInChI = 1S/C57H70N12O9S2/c1-32(2)49-57(78)68-48(55(76)64-44(50(60)71)26-35-28-61-41-16-8-6-14-38(35)41)31-80-79-30-47(67-51(72)40(59)24-33-12-4-3-5-13-33)56(77)65-45(25-34-19-21-37(70)22-20-34)53(74)66-46(27-36-29-62-42-17-9-7-15-39(36)42)54(75)63-43(52(73)69-49)18-10-11-23-58/h3-9,12-17,19-22,28-29,32,40,43-49,61-62,70H,10-11,18,23-27,30-31,58-59H2,1-2H3,(H2,60,71)(H,63,75)(H,64,76)(H,65,77)(H,66,74)(H,67,72)(H,68,78)(H,69,73)/t40-,43+,44+,45+,46-,47+,48+,49+/m1/s1

| StdInChIKey = SWXOGPJRIDTIRL-DOUNNPEJSA-N

| density = 1.4

| melting_point =

| melting_high =

| melting_notes =

| boiling_point = 1540.9

| boiling_notes =

| solubility =

| specific_rotation =

| sec_combustion =

}}

Vapreotide (Sanvar) is a synthetic somatostatin analog. It is used in the treatment of esophageal variceal bleeding{{cite journal | vauthors = Calès P | title = Vapreotide acetate for the treatment of esophageal variceal bleeding | journal = Expert Review of Gastroenterology & Hepatology | volume = 2 | issue = 2 | pages = 185–92 | date = April 2008 | pmid = 19072353 | doi = 10.1586/17474124.2.2.185 | s2cid = 2681639 }}{{cite journal | vauthors = Fortune BE, Jackson J, Leonard J, Trotter JF | title = Vapreotide: a somatostatin analog for the treatment of acute variceal bleeding | journal = Expert Opinion on Pharmacotherapy | volume = 10 | issue = 14 | pages = 2337–42 | date = October 2009 | pmid = 19708854 | doi = 10.1517/14656560903207019 | s2cid = 24475861 }} in patients with cirrhotic liver disease and AIDS-related diarrhea.{{DrugBank|DB04894}}

It is an 8 residue peptide with sequence H-D-Phe-Cys(1)-Tyr-D-Trp-Lys-Val-Cys(1)-Trp-NH2.

References

{{Reflist}}

{{GH/IGF-1 axis signaling modulators}}

Category:Antineoplastic drugs

Category:Lactams

Category:Peptides

Category:Somatostatin inhibitors

{{systemic-hormonal-drug-stub}}