Varixanthone

{{Chembox

| ImageFile = Varixanthone.svg

| ImageSize = 200px

| ImageAlt =

| PIN = (2S)-3-Hydroxy-1-[(1R,2S)-11-hydroxy-5-methyl-12-oxo-1,2,3,12-tetrahydropyrano[3,2-a]xanthen-8-yl]-3-methylbutan-2-yl formate

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 419568-69-7

| CASNo_Ref = {{Cascite|changed|{{cite web |title=KNApSAcK Metabolite Information - C00045432 |url=http://www.knapsackfamily.com/knapsack_core/information.php?word=C00045432 |website=www.knapsackfamily.com}}}}

| ChEBI = 211684

| ChEMBL = 469656

| PubChem = 10096170

| SMILES = CC1=CC2=C(C3=C1OC[C@@H]([C@H]3O)C(=C)C)C(=O)C4=C(C=CC(=C4O2)C[C@@H](C(C)(C)O)OC=O)O

| InChI = 1S/C26H28O8/c1-12(2)15-10-32-24-13(3)8-17-20(21(24)22(15)29)23(30)19-16(28)7-6-14(25(19)34-17)9-18(33-11-27)26(4,5)31/h6-8,11,15,18,22,28-29,31H,1,9-10H2,2-5H3/t15-,18+,22-/m1/s1

| InChIKey = GOKVXLNHAYUYGV-FXCLAUTBSA-N

| ChemSpiderID = 8271705 }}

|Section2={{Chembox Properties

| C=26 | H=28 | O=8

| Appearance =

| Density =

| MeltingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Varixanthone is an antimicrobial made by the marine fungus Emericella variecolor.{{cite journal |last1=Malmstrøm |first1=J |last2=Christophersen |first2=C |last3=Barrero |first3=AF |last4=Oltra |first4=JE |last5=Justicia |first5=J |last6=Rosales |first6=A |title=Bioactive metabolites from a marine-derived strain of the fungus Emericella variecolor. |journal=Journal of Natural Products |date=March 2002 |volume=65 |issue=3 |pages=364–7 |doi=10.1021/np0103214 |pmid=11908979}}