Vat Green 1

{{Chembox

| ImageFile = Vat Green 1.svg

| ImageSize = 250

| ImageAlt =

| PIN = 16,17-Dimethoxydinaphtho[1,2,3-cd:3′,2′,1′-lm]perylene-5,10-dione

| OtherNames = Jade Green Base; Brilliant Green S; Mayvat Jade Green; Indanthren Brilliant Green B

|Section1={{Chembox Identifiers

| CASNo = 128-58-5

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 5C13513T4R

| EINECS = 204-896-6

| PubChem = 31410

| ChemSpiderID = 29140

| SMILES = COC1=C2C3=C(C=CC4=C3C(=C1)C5=CC=CC=C5C4=O)C6=C7C2=C(C=C8C7=C(C=C6)C(=O)C9=CC=CC=C98)OC

| InChI = 1/C36H20O4/c1-39-27-15-25-17-7-3-5-9-21(17)35(37)23-13-11-19-20-12-14-24-30-26(18-8-4-6-10-22(18)36(24)38)16-28(40-2)34(32(20)30)33(27)31(19)29(23)25/h3-16H,1-2H3

| InChIKey = JXUKQCUPTNLTCS-UHFFFAOYAK

| StdInChI = 1S/C36H20O4/c1-39-27-15-25-17-7-3-5-9-21(17)35(37)23-13-11-19-20-12-14-24-30-26(18-8-4-6-10-22(18)36(24)38)16-28(40-2)34(32(20)30)33(27)31(19)29(23)25/h3-16H,1-2H3

| StdInChIKey = JXUKQCUPTNLTCS-UHFFFAOYSA-N}}

|Section2={{Chembox Properties

| C=36 | H=20 | O=4

| Appearance = dark green solid

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Vat Green 1 is an organic compound that is used as a vat dye.{{ Ullmann | author = Bien, H.-S.; Stawitz, J.; Wunderlich, K. | title = Anthraquinone Dyes and Intermediates | doi = 10.1002/14356007.a02_355 }} It is a derivative of benzanthrone.{{cite web |url=http://www.worlddyevariety.com/vat-dyes/vat-green-1.html |title=Vat Green 1}} It is a dark green solid.{{cite web |url=http://www.chemicalbook.com/ProductChemicalPropertiesCB2346373_EN.htm |title=Vat Green 1 Basic information}} Vat Green 1 can dye viscose, silk, wool, paper, and soap.{{cite web |url=http://hazmap.nlm.nih.gov/category-details?table=copytblagents&id=4116|title= Vat Green 1}}