Vebreltinib

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name = Vebreltinib

| INN =

| type =

| image = Vebreltinib.svg

| alt =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| routes_of_administration = Oral

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status = Rx in China

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action=

| excretion =

| synonyms = Bozitinib; APL-101; PBL-1001

| CAS_number = 1440964-89-5

| PubChem = 72202701

| ChemSpiderID = 72388443

| UNII = 2WZP8A9VFN

| DrugBank = DB16823

| ChEMBL = 4650443

| IUPAC_name = 6-(1-Cyclopropylpyrazol-4-yl)-3-[difluoro-(6-fluoro-2-methylindazol-5-yl)methyl]-[1,2,4]triazolo[4,3-b]pyridazine

| C = 20 | H = 15 | F = 3 | N = 8

| SMILES = CN1C=C2C=C(C(=CC2=N1)F)C(C3=NN=C4N3N=C(C=C4)C5=CN(N=C5)C6CC6)(F)F

| StdInChI = 1S/C20H15F3N8/c1-29-9-11-6-14(15(21)7-17(11)27-29)20(22,23)19-26-25-18-5-4-16(28-31(18)19)12-8-24-30(10-12)13-2-3-13/h4-10,13H,2-3H2,1H3

| StdInChIKey = QHXLXUIZUCJRKV-UHFFFAOYSA-N

}}

Vebreltinib (also known as bozitinib) is a pharmaceutical drug used for the treatment of cancer.{{cite journal | vauthors = Hong L, Zhang J, Heymach JV, Le X | title = Current and future treatment options for MET exon 14 skipping alterations in non-small cell lung cancer | journal = Therapeutic Advances in Medical Oncology | volume = 13 | pages = 1758835921992976 | date = 2021 | pmid = 33643443 | doi = 10.1177/1758835921992976 | pmc = 7890719 }}{{cite journal | vauthors = Han Y, Yu Y, Miao D, Zhou M, Zhao J, Shao Z, Jin R, Le X, Li W, Xia Y | title = Targeting MET in NSCLC: An Ever-Expanding Territory | journal = JTO Clinical and Research Reports | volume = 5 | issue = 2 | pages = 100630 | date = February 2024 | pmid = 38361739 | pmc = 10867448 | doi = 10.1016/j.jtocrr.2023.100630 }}

Vebreltinib selectively binds to c-Met, preventing its phosphorylation and thereby disrupting c-Met signal transduction pathways.{{cite web | url = https://www.cancer.gov/publications/dictionaries/cancer-drug/def/vebreltinib | work = NCI Drug Dictionary | title = Vebreltinib | publisher = U.S. National Institutes of Health }}

In China, it is approved for the treatment of non-small-cell lung cancer (NSCLC) with MET exon 14 skipping mutations.{{cite news | url = https://www.onclive.com/view/vebreltinib-receives-approval-in-china-for-met-exon-14-nsclc | website = onclive.com | title = Vebreltinib Receives Approval in China For MET Exon 14+ NSCLC | date = November 16, 2023 }}