Verrulactone

{{Chembox

|ImageFile=image:Verrulactone A Structure.svg

|ImageCaption=Chemical structure of verrulactone A

|Section1={{Chembox Identifiers

|index1_label=A

|index2_label=B

| CASNo1 = 1369367-58-7

| CASNo1_Ref = {{Cascite|changed|EPA}}

| CASNo2 = 1369367-59-8

| CASNo2_Ref = {{Cascite|changed|EPA}}

| ChEBI1 = 206505

| ChEBI2 = 199104

|PubChem1=57404538

|PubChem2=57404245

| ChEMBL1 = 2011360

| ChEMBL2 = 2011361

| ChemSpiderID1 = 28289569

| ChemSpiderID2 = 28516662

| DTXSID1 = DTXSID401336395

| InChI1=1S/C28H18O12/c1-37-9-3-11-19(13(29)5-9)27(35)39-17-7-15(31)25(33)23(21(11)17)24-22-12-4-10(38-2)6-14(30)20(12)28(36)40-18(22)8-16(32)26(24)34/h3-8,29-34H,1-2H3

| InChIKey1 = ZSHZQCWUSDSOFB-UHFFFAOYSA-N

| SMILES1 = COC1=CC2=C(C(=C1)O)C(=O)OC3=C2C(=C(C(=C3)O)O)C4=C(C(=CC5=C4C6=C(C(=CC(=C6)OC)O)C(=O)O5)O)O

| InChI2=1S/C28H18O12/c1-37-9-3-11-12-7-16(31)25(34)23(26(12)40-28(36)19(11)14(29)5-9)22-21-13-4-10(38-2)6-15(30)20(13)27(35)39-18(21)8-17(32)24(22)33/h3-8,29-34H,1-2H3

| InChIKey2 = KILSNFDREQHTBU-UHFFFAOYSA-N

| SMILES2 = COC1=CC2=C(C(=C1)O)C(=O)OC3=C(C(=C(C=C23)O)O)C4=C(C(=CC5=C4C6=C(C(=CC(=C6)OC)O)C(=O)O5)O)O

}}

}}

Verrulactones are alternariol-derived antimicrobial chemical compounds isolated from Penicillium.{{cite journal | pmid = 22377515 | year = 2012 | last1 = Kim | first1 = N. | title = Verrulactones a and B, new inhibitors of Staphylococcus aureus enoyl-ACP reductase produced by Penicillium verruculosum F375 | journal = Bioorganic & Medicinal Chemistry Letters | volume = 22 | issue = 7 | pages = 2503–6 | last2 = Sohn | first2 = M. J. | last3 = Kim | first3 = C. J. | last4 = Kwon | first4 = H. J. | last5 = Kim | first5 = W. G. | doi = 10.1016/j.bmcl.2012.02.001 }}