Vestipitant

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 399133414

| IUPAC_name = (2S)-N-{(1R)-1-[3,5-bis(trifluoromethyl)
phenyl]ethyl}-2-(4-fluoro-2-methylphenyl)-N-methylpiperazine-1-carboxamide

| image = Vestipitant structure.svg

| width = 225

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| bioavailability =

| protein_bound =

| metabolism =

| excretion =

| index2_label = Mesylate

| CAS_number2_Ref = {{cascite|correct|CAS}}

| CAS_number2 = 334476-64-1

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = OWR424W90Q

| IUPHAR_ligand = 5757

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 334476-46-9

| CAS_supplemental =

| ATC_prefix = None

| ATC_suffix =

| PubChem = 9832383

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = S052TOI9BI

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 522987

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 8008111

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = D06293

| C=23 | H=21 | F=10 | N=3 | O=1

| smiles = FC(F)(F)c1cc(F)ccc1C2CNCCN2C(=O)N(C)C(C)c3cc(C(F)(F)F)cc(c3)C(F)(F)F

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C23H24F7N3O/c1-13-8-18(24)4-5-19(13)20-12-31-6-7-33(20)21(34)32(3)14(2)15-9-16(22(25,26)27)11-17(10-15)23(28,29)30/h4-5,8-11,14,20,31H,6-7,12H2,1-3H3/t14-,20-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = SBBYBXSFWOLDDG-JLTOFOAXSA-N

}}

Vestipitant (INN){{cite web | title=International Nonproprietary Names for Pharmaceutical Substances (INN). Recommended International Nonproprietary Names: List 53 | url =https://www.who.int/medicines/publications/druginformation/innlists/RL53.pdf | publisher = World Health Organization | access-date = 17 November 2016}}{{rp|98}} is a drug developed by GlaxoSmithKline which acts as a selective antagonist for the NK₁ receptor. It is under development as a potential antiemetic and anxiolytic drug,{{cite journal | vauthors = Reddy GK, Gralla RJ, Hesketh PJ | title = Novel neurokinin-1 antagonists as antiemetics for the treatment of chemotherapy-induced emesis | journal = Supportive Cancer Therapy | volume = 3 | issue = 3 | pages = 140–2 | date = April 2006 | pmid = 18632487 | doi = 10.3816/SCT.2006.n.011 }}{{cite journal | vauthors = Brocco M, Dekeyne A, Mannoury la Cour C, Touzard M, Girardon S, Veiga S, de Nanteuil G, deJong TR, Olivier B, Millan MJ | display-authors = 6 | title = Cellular and behavioural profile of the novel, selective neurokinin1 receptor antagonist, vestipitant: a comparison to other agents | journal = European Neuropsychopharmacology | volume = 18 | issue = 10 | pages = 729–50 | date = October 2008 | pmid = 18657401 | doi = 10.1016/j.euroneuro.2008.06.002 | s2cid = 8258896 }} and as a treatment for tinnitus{{ClinicalTrialsGov|NCT00394056|Vestipitant Or Vestipitant/Paroxetine Combination In Subjects With Tinnitus And Hearing Loss}} and insomnia.{{cite journal | vauthors = Ratti E, Carpenter DJ, Zamuner S, Fernandes S, Squassante L, Danker-Hopfe H, Archer G, Robertson J, Alexander R, Trist DG, Merlo-Pich E | display-authors = 6 | title = Efficacy of vestipitant, a neurokinin-1 receptor antagonist, in primary insomnia | journal = Sleep | volume = 36 | issue = 12 | pages = 1823–30 | date = December 2013 | pmid = 24293756 | pmc = 3825431 | doi = 10.5665/sleep.3208 }}