Vinylbital

{{short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 470630727

| IUPAC_name = 5-(1-methylbutyl)-5-vinylpyrimidine-2,4,6(1H,3H,5H)-trione

| image = Vinylbital structure.svg

| image_class = skin-invert-image

| width = 150

| tradename =

| pregnancy_category =

| legal_BR = B1

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}

| legal_CA = Schedule IV

| legal_US = Schedule IV

| legal_DE = Anlage II

| routes_of_administration = Oral

| bioavailability =

| metabolism = Hepatic

| elimination_half-life =

| excretion = Renal

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 2430-49-1

| ATC_prefix = N05

| ATC_suffix = CA08

| PubChem = 72135

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 65109

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 3W58ITX06Q

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07321

| C=11 | H=16 | N=2 | O=3

| smiles = O=C1NC(=O)NC(=O)C1(\C=C)C(C)CCC

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C11H16N2O3/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15/h5,7H,2,4,6H2,1,3H3,(H2,12,13,14,15,16)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = KGKJZEKQJQQOTD-UHFFFAOYSA-N

}}

Vinylbital, also known as butylvinal, is a sedative hypnotic drug which is a barbiturate derivative.{{cite journal | vauthors = Breimer DD, de Boer AG | title = Pharmacokinetics and relative bioavailability of vinylbital in man after oral and rectal administration | journal = Arzneimittel-Forschung | volume = 26 | issue = 3 | pages = 448–54 | year = 1976 | pmid = 989344 }} It was developed by Aktiebolaget Pharmacia in the 1950s.{{cite patent | inventor = Brandstrom AE | title = Manufacture of Barbituric Acid Compounds | country = US | number = 2868790 | gdate = 13 January 1959 | assign1 = Pharmacia }}{{Failed verification|reason=Patent about allyl barbiturates, not vinyl|date=March 2023}}