Virapinib

{{Short description|Antiviral drug}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{infobox drug

| drug_name = Virapinib

| image = Virapinib_structure.png

| legal_UK =

| legal_DE =

| C = 26 | H = 36 | N = 6 | O = 1

| IUPAC_name = [3-[7-methyl-4-(methylamino)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]pyrrolidin-1-yl]-[4-(4-methylpiperidin-1-yl)phenyl]methanone

| CAS_number = 1794091-10-3

| ChEMBL =

| DrugBank =

| ChemSpiderID = 29964516

| PubChem = 127251916

| UNII =

| smiles = CC1CCN(CC1)C2=CC=C(C=C2)C(=O)N3CCC(C3)C4=NC5=C(CCN(C5)C)C(=N4)NC

| StdInChI= 1S/C26H36N6O/c1-18-8-13-31(14-9-18)21-6-4-19(5-7-21)26(33)32-15-10-20(16-32)24-28-23-17-30(3)12-11-22(23)25(27-2)29-24/h4-7,18,20H,8-17H2,1-3H3,(H,27,28,29)

| StdInChIKey = LUAVWTOZVHIDSI-UHFFFAOYSA-N

}}

Virapinib is an antiviral drug which is the first drug developed that acts by inhibiting viral entry into cells via macropinocytosis. While it is only in early developmental stages, initial testing showed broad spectrum antiviral activity against a range of viruses including SARS-CoV-2, Monkeypox virus, Ebolavirus and tick-borne encephalitis virus.{{cite journal | vauthors = Porebski B, Christ W, Corman A, Haraldsson M, Barz M, Lidemalm L, Häggblad M, Ilmain J, Wright SC, Murga M, Schlegel J, Jarvius M, Lapins M, Sezgin E, Bhabha G, Lauschke VM, Carreras-Puigvert J, Lafarga M, Klingström J, Hühn D, Fernandez-Capetillo O | title = Discovery of a novel inhibitor of macropinocytosis with antiviral activity | journal = Molecular Therapy | date = July 2024 | pmid = 38956870 | doi = 10.1016/j.ymthe.2024.06.038 | doi-access = free | hdl = 10902/34119 | hdl-access = free }}