Viscumamide

{{Short description|Chemical compound}}

{{Chembox

| ImageFile = Viscumamide Structure.svg

| ImageSize =

| IUPACName = Cyclo(isoleucylleucylisoleucylleucylleucyl)

| OtherNames = Cyclic(L-isoleucyl-L-leucyl-L-isoleucyl-L-leucyl-L-leucyl)

|Section1={{Chembox Identifiers

| CASNo = 38184-76-8

| PubChem = 559969

| ChemSpiderID = 486785

| SMILES = [C@@H](CC)(C)[C@]1(C(=O)N[C@@H](CC(C)C)C(=O)N[C@@]([C@H](CC)C)(C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N1)[H])[H]

| StdInChI=1S/C30H55N5O5/c1-11-19(9)24-29(39)32-21(13-16(3)4)26(36)31-22(14-17(5)6)27(37)34-25(20(10)12-2)30(40)33-23(15-18(7)8)28(38)35-24/h16-25H,11-15H2,1-10H3,(H,31,36)(H,32,39)(H,33,40)(H,34,37)(H,35,38)

| StdInChIKey = KACXIDDXMHJUSH-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=30 | H=55 | N=5 | O=5

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Viscumamide is a cyclic peptide isolated from endophytic fungi of mangrove.{{cite journal | pmid = 18422185 | year = 2007 | last1 = Guo | first1 = ZY | last2 = Huang | first2 = ZJ | last3 = Wen | first3 = L | last4 = Wan | first4 = Q | last5 = Liu | first5 = F | last6 = She | first6 = ZG | last7 = Lin | first7 = YC | last8 = Zhou | first8 = SN | title = The metabolites of cyclic peptides from three endophytic mangrove fungi | volume = 30 | issue = 12 | pages = 1526–9 | journal = Zhong Yao Cai}}