Vobtusine

{{Chembox

| ImageFile = vobtusine.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName =

| OtherNames =

| Section1 = {{Chembox Identifiers

| CASNo = 19772-79-3

| PubChem = 73534

| ChemSpiderID = 66217

| ChEBI = 10016

| ChEMBL =

| SMILES = COC1=CC=CC2=C1N3C[C@]4(C[C@H]5[C@]3([C@]26CCN7[C@H]6[C@@]8(C5)CCO[C@H]8CC7)O)CN9CC[C@@]12[C@@H]9[C@@]3([C@H]4OCC3)CC(=C1NC1=CC=CC=C21)C(=O)OC

| StdInChI =1S/C43H50N4O6/c1-50-30-9-5-7-28-32(30)47-24-38(20-25-21-39-13-18-52-31(39)10-15-45-17-12-42(28,36(39)45)43(25,47)49)23-46-16-11-41-27-6-3-4-8-29(27)44-33(41)26(34(48)51-2)22-40(35(41)46)14-19-53-37(38)40/h3-9,25,31,35-37,44,49H,10-24H2,1-2H3/t25-,31+,35+,36+,37+,38+,39-,40+,41+,42-,43-/m1/s1

| StdInChIKey = IIMPGJMHQMBXKL-OPDPKHDKSA-N

}}

| Section2 = {{Chembox Properties

| C=43 | H=50 | N=4 | O=6

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Vobtusine is an alkaloid found in several different plants in the genus Voacanga.{{cite journal |url=https://www.erowid.org/plants/voacanga_africana/voacanga_africana_info1.shtml |journal=Agricultural University Wageningen Papers |issn=0169-345X |volume=85 |issue=3 |year=1985 |title=Voacanga, (Apocynaceae), a review of its taxonomy, phytochemistry, ethnobotany and pharmacology| vauthors = Leeuwenberg AJ |author1-link=Anthonius Josephus Maria Leeuwenberg}}