WAY-181187

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 2-(1-{6-Chloroimidazo[2,1-b][1,3]thiazole-5-sulfonyl}-1H-indol-3-yl)ethan-1-amine

| image = WAY-181,187.svg

| width = 200

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 3240

| CAS_number = 554403-49-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = WXE3H7W295

| ATC_prefix = none

| ATC_suffix =

| PubChem = 10150497

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 392760

| ChemSpiderID = 8326005

| C=15 | H=13 | Cl=1 | N=4 | O=2 | S=2

| smiles = NCCc1cn(c2ccccc12)S(=O)(=O)c1c(Cl)nc2sccn12

| StdInChI = 1S/C15H13ClN4O2S2/c16-13-14(19-7-8-23-15(19)18-13)24(21,22)20-9-10(5-6-17)11-3-1-2-4-12(11)20/h1-4,7-9H,5-6,17H2

| StdInChIKey = RYBOXBBYCVOYNO-UHFFFAOYSA-N

}}

WAY-181187 is a high affinity and selective 5-HT₆ receptor full agonist.{{cite journal |vauthors=Schechter LE, Lin Q, Smith DL, etal | title = Neuropharmacological profile of novel and selective 5-HT6 receptor agonists: WAY-181187 and WAY-208466 | journal = Neuropsychopharmacology | volume = 33 | issue = 6 | pages = 1323–35 |date=May 2008 | pmid = 17625499 | doi = 10.1038/sj.npp.1301503 | doi-access = free }}{{cite journal |vauthors=Cole DC, Stock JR, Lennox WJ, etal | title = Discovery of N1-(6-chloroimidazo[2,1-b][1,3]thiazole-5-sulfonyl)tryptamine as a potent, selective, and orally active 5-HT(6) receptor agonist | journal = Journal of Medicinal Chemistry | volume = 50 | issue = 23 | pages = 5535–8 |date=November 2007 | pmid = 17948978 | doi = 10.1021/jm070521y }} It induces robust increases in extracellular GABA levels in the frontal cortex, hippocampus, striatum, and amygdala of rats without affecting concentrations in the nucleus accumbens or thalamus, and has modest to no effects on norepinephrine, serotonin, dopamine, or glutamate levels in these areas.{{cite journal |vauthors=West PJ, Marcy VR, Marino MJ, Schaffhauser H | title = Activation of the 5-HT(6) receptor attenuates long-term potentiation and facilitates GABAergic neurotransmission in rat hippocampus | journal = Neuroscience | volume = 164 | issue = 2 | pages = 692–701 |date=December 2009 | pmid = 19660530 | doi = 10.1016/j.neuroscience.2009.07.061 | s2cid = 207246603 }} WAY-181187 has demonstrated preclinical efficacy in rodent models of depression, anxiety, and notably obsessive-compulsive disorder,{{cite journal |vauthors=Carr GV, Schechter LE, Lucki I | title = Antidepressant and anxiolytic effects of selective 5-HT(6) receptor agonists in rats | journal = Psychopharmacology | volume = 213| issue = 2–3| pages = 499–507|date=March 2010 | pmid = 20217056 | doi = 10.1007/s00213-010-1798-7 | pmc=2910165}} though it has also been shown to impair cognition and memory.{{cite journal |vauthors=Loiseau F, Dekeyne A, Millan MJ | title = Pro-cognitive effects of 5-HT6 receptor antagonists in the social recognition procedure in rats: implication of the frontal cortex | journal = Psychopharmacology | volume = 196 | issue = 1 | pages = 93–104 |date=January 2008 | pmid = 17922111 | doi = 10.1007/s00213-007-0934-5 | s2cid = 35795618 }}