WAY-317538

{{short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 451554242

| IUPAC_name = 5-Morpholin-4-yl-pentanoic acid (4-pyridin-3-yl-phenyl)-amide

| image = WAY-317538.svg

| width = 240

| tradename =

| legal_status = Legal

| routes_of_administration =

| index_label =

| index2_label = HCl

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 874450-44-9

| ATC_suffix =

| PubChem = 45484303

| PubChem2 = 45484302

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1084615

| ChEMBL2_Ref = {{ebicite|changed|EBI}}

| ChEMBL2 = 565540

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 24663034

| UNII = M92TU1EZ75

| C=20 | H=25 | N=3 | O=2

| smiles = C3COCCN3CCCCC(=O)Nc1ccc(cc1)-c2cccnc2

| SMILES2 = C1COCCN1CCCCC(=O)NC2=CC=C(C=C2)C3=CN=CC=C3.Cl

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C20H25N3O2/c24-20(5-1-2-11-23-12-14-25-15-13-23)22-19-8-6-17(7-9-19)18-4-3-10-21-16-18/h3-4,6-10,16H,1-2,5,11-15H2,(H,22,24)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = XCHIZTUBUXZESJ-UHFFFAOYSA-N

| StdInChI2=1S/C20H25N3O2.ClH/c24-20(5-1-2-11-23-12-14-25-15-13-23)22-19-8-6-17(7-9-19)18-4-3-10-21-16-18;/h3-4,6-10,16H,1-2,5,11-15H2,(H,22,24);1H

| StdInChIKey2 = GBMDUJQQSGOIFW-UHFFFAOYSA-N

}}

WAY-317538 (SEN-12333) is a drug that acts as a potent and selective full agonist for the α7 subtype of neural nicotinic acetylcholine receptors. It was not the most potent compound in the series, but was selected for further development on the basis of its high selectivity over related receptors, ease of synthesis, and good in vivo properties including high oral bioavailability and good brain penetration.{{cite journal | vauthors = Haydar SN, Ghiron C, Bettinetti L, Bothmann H, Comery TA, Dunlop J, La Rosa S, Micco I, Pollastrini M, Quinn J, Roncarati R, Scali C, Valacchi M, Varrone M, Zanaletti R | display-authors = 6 | title = SAR and biological evaluation of SEN12333/WAY-317538: Novel alpha 7 nicotinic acetylcholine receptor agonist | journal = Bioorganic & Medicinal Chemistry | volume = 17 | issue = 14 | pages = 5247–58 | date = July 2009 | pmid = 19515567 | doi = 10.1016/j.bmc.2009.05.040 }} It has nootropic and neuroprotective effects in animal studies, and is being investigated as a potential treatment for neurodegenerative and neurocognitive conditions including Alzheimer's disease and schizophrenia.{{cite journal | vauthors = Roncarati R, Scali C, Comery TA, Grauer SM, Aschmi S, Bothmann H, Jow B, Kowal D, Gianfriddo M, Kelley C, Zanelli U, Ghiron C, Haydar S, Dunlop J, Terstappen GC | display-authors = 6 | title = Procognitive and neuroprotective activity of a novel alpha7 nicotinic acetylcholine receptor agonist for treatment of neurodegenerative and cognitive disorders | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 329 | issue = 2 | pages = 459–68 | date = May 2009 | pmid = 19223665 | doi = 10.1124/jpet.108.150094 | s2cid = 6667145 }}