Xanthomycin A

{{Chembox

| ImageFile = Xanthomycin A Structure.svg

| ImageSize =

| ImageAlt =

| IUPACName =

| OtherNames = Guamecycline; Tetrabiguanide

|Section1={{Chembox Identifiers

| CASNo = 16545-11-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 4NQR4R6G3S

| CASNo_Ref = {{cascite|correct|CAS}}

| PubChem = 54688683

| ChemSpiderID = 58190541

| StdInChI = 1S/C29H38N8O8/c1-28(44)13-5-4-6-16(38)17(13)21(39)18-14(28)11-15-20(35(2)3)22(40)19(24(42)29(15,45)23(18)41)25(43)33-12-36-7-9-37(10-8-36)27(32)34-26(30)31/h4-6,14-15,20,38-39,42,44-45H,7-12H2,1-3H3,(H,33,43)(H5,30,31,32,34)/t14-,15-,20-,28+,29-/m0/s1

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FAMUIRDLAWWMCQ-AQFAATAFSA-N

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| SMILES = C[C@]1(c2cccc(c2C(=C3[C@@H]1C[C@H]4[C@@H](C(=O)C(=C([C@]4(C3=O)O)O)C(=O)NCN5CCN(CC5)C(=N)N=C(N)N)N(C)C)O)O)O

}}

|Section2={{Chembox Properties

| C=29 | H=38 | N=8 | O=8

| Formula =

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Xanthomycin A is an antibiotic with in vitro antitumor activity isolated from Streptomyces.{{Cite journal |last=Nishimura T, Kitajima J, Omura S, Tanaka N |date=1981 |title=Antitumor activity of an antibiotic identical with or closely related to xanthomycin A |journal=J Antibiot |volume=34 |issue=7 |pages=856–861 |doi=10.7164/antibiotics.34.856 |pmid=7287588 |doi-access=free}}