YM-348

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 449588937

| IUPAC_name = (2S)-1-(7-ethyl-1H-furo[2,3-g]indazol-1-yl)propan-2-amine

| image = YM-348.svg

| width = 220

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 230

| CAS_number = 372163-84-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = VTV38S7D39

| ATC_prefix =

| ATC_suffix =

| PubChem = 3045225

| ChemSpiderID = 2308001

| StdInChI = 1S/C14H17N3O/c1-3-11-6-12-13(18-11)5-4-10-7-16-17(14(10)12)8-9(2)15/h4-7,9H,3,8,15H2,1-2H3/t9-/m0/s1

| StdInChIKey = QLOOWOVVZLBYHU-VIFPVBQESA-N

| C=14 | H=17 | N=3 | O=1

| smiles = n3cc2ccc1oc(cc1c2n3C[C@@H](N)C)CC

| melting_point =

| melting_high =

}}

YM-348 is an indazole derivative drug which acts as a potent and selective 5-HT_2C receptor agonist, with an EC₅₀ of 1nM and 15x selectivity over 5-HT_2A, although it only has moderate selectivity of 3x over the closely related 5-HT_2B receptor.{{cite journal | vauthors = Kimura Y, Hatanaka K, Naitou Y, Maeno K, Shimada I, Koakutsu A, Wanibuchi F, Yamaguchi T | display-authors = 6 | title = Pharmacological profile of YM348, a novel, potent and orally active 5-HT2C receptor agonist | journal = European Journal of Pharmacology | volume = 483 | issue = 1 | pages = 37–43 | date = January 2004 | pmid = 14709324 | doi = 10.1016/j.ejphar.2003.10.004 }}{{cite journal | vauthors = Shimada I, Maeno K, Kazuta K, Kubota H, Kimizuka T, Kimura Y, Hatanaka K, Naitou Y, Wanibuchi F, Sakamoto S, Tsukamoto S | display-authors = 6 | title = Synthesis and structure-activity relationships of a series of substituted 2-(1H-furo[2,3-g]indazol-1-yl)ethylamine derivatives as 5-HT2C receptor agonists | journal = Bioorganic & Medicinal Chemistry | volume = 16 | issue = 4 | pages = 1966–82 | date = February 2008 | pmid = 18035544 | doi = 10.1016/j.bmc.2007.10.100 }} It has thermogenic and anorectic effects in animal studies, making it potentially useful for the treatment of obesity.{{cite journal | vauthors = Hayashi A, Sonoda R, Kimura Y, Takasu T, Suzuki M, Sasamata M, Miyata K | title = Antiobesity effect of YM348, a novel 5-HT2C receptor agonist, in Zucker rats | journal = Brain Research | volume = 1011 | issue = 2 | pages = 221–7 | date = June 2004 | pmid = 15157808 | doi = 10.1016/j.brainres.2004.03.032 | s2cid = 23199460 }}{{cite journal | vauthors = Smith BM, Thomsen WJ, Grottick AJ | title = The potential use of selective 5-HT2C agonists in treating obesity | journal = Expert Opinion on Investigational Drugs | volume = 15 | issue = 3 | pages = 257–66 | date = March 2006 | pmid = 16503763 | doi = 10.1517/13543784.15.3.257 | s2cid = 22100586 }}{{cite journal | vauthors = Nilsson BM | title = 5-Hydroxytryptamine 2C (5-HT2C) receptor agonists as potential antiobesity agents | journal = Journal of Medicinal Chemistry | volume = 49 | issue = 14 | pages = 4023–34 | date = July 2006 | pmid = 16821762 | doi = 10.1021/jm058240i }}{{cite journal | vauthors = Wacker DA, Miller KJ | title = Agonists of the serotonin 5-HT2C receptor: preclinical and clinical progression in multiple diseases | journal = Current Opinion in Drug Discovery & Development | volume = 11 | issue = 4 | pages = 438–45 | date = July 2008 | pmid = 18600561 }}