Yellow 2G

{{Use dmy dates|date=January 2023}}

{{chembox

| Verifiedfields = changed

| verifiedrevid = 470634627

| ImageFile = Yellow 2G sodium.svg

| ImageSize = 250px

| IUPACName = Disodium 2,5-dichloro-4-[3-methyl-5-oxo-4-(4-sulfonatophenyl)diazenyl-4H-pyrazol-1-yl]benzenesulfonate

| OtherNames = {{Unbulleted list|Lissamine Fast Yellow|C.I. Acid Yellow 17|C.I. 18965|Light Fast Yellow 2G|C.I. Food Yellow 5|Acid Leather Yellow 2GL|Erio Flavine SX|Fenalan Yellow G|Erio Flavine 3G|Kayacyl Yellow GG}}

| Section1 = {{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 3490830

| index2_label=tautomer

| ChEBI2_Ref = {{ebicite|changed|EBI}}

| ChEBI2 = 90206

| StdInChI=1S/C16H12Cl2N4O7S2.2Na/c1-8-15(20-19-9-2-4-10(5-3-9)30(24,25)26)16(23)22(21-8)13-6-12(18)14(7-11(13)17)31(27,28)29;;/h2-7,15H,1H3,(H,24,25,26)(H,27,28,29);;/q;2*+1/p-2

| StdInChIKey = FTZLWXQKVFFWLY-UHFFFAOYSA-L

| InChI1 = 1S/C16H12Cl2N4O7S2/c1-8-15(20-19-9-2-4-10(5-3-9)30(24,25)26)16(23)22(21-8)13-6-12(18)14(7-11(13)17)31(27,28)29/h2-7,15H,1H3,(H,24,25,26)(H,27,28,29)/p-2/b20-19+

| InChIKey1 = DWYWPBYWDAZKNX-FMQUCBEESA-L

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 6359-98-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = Y428W9WW4D

| PubChem = 22842

| index1_label = acid

| PubChem1 = 4284331

| SMILES = CC1=NN(C(=O)C1N=NC2=CC=C(C=C2)S(=O)(=O)[O-])C3=CC(=C(C=C3Cl)S(=O)(=O)[O-])Cl.[Na+].[Na+]

}}

| Section2 = {{Chembox Properties

| C=16 | H=10 | Na=2 | N=4 | O=7 | S=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Yellow 2G is a food coloring denoted by E number E107 with the color index CI18965. It has the appearance of a yellow powder, and it is soluble in water. It is a synthetic yellow azo dye.

It is not listed by the UK's Food Standards Agency among EU approved food additives.[http://www.food.gov.uk/safereating/chemsafe/additivesbranch/enumberlist Current EU approved additives and their E Numbers], Food Standards Agency, 26 November 2010 Its use is also banned in Austria, Japan, Norway, Sweden, Switzerland and the United States.{{Citation needed|date=January 2011}}