ZC-B

{{Short description|Chemical compound}}

{{drugbox

| drug_name = ZC-B

| image = WO2021-0137908-1 structure.png

| legal_UK =

| legal_DE =

| C = 11 | H = 14 | Br = 1 | N = 1 | O = 2

| IUPAC_name = 3-(4-bromo-2,5-dimethoxyphenyl)azetidine

| CAS_number = 2641630-65-9

| ChEMBL =

| ChemSpiderID =

| PubChem = 156337249

| UNII = 9EP4MV3URL

| smiles = COC1=CC(=C(C=C1C2CNC2)OC)Br

| StdInChI = 1S/C11H14BrNO2/c1-14-10-4-9(12)11(15-2)3-8(10)7-5-13-6-7/h3-4,7,13H,5-6H2,1-2H3

| StdInChIKey = YFCASESLVDHSAW-UHFFFAOYSA-N

}}

ZC-B (3-(4-bromo-2,5-dimethoxyphenyl)azetidine) is a phenethylamine derivative which acts as a serotonin receptor agonist selective for the 5-HT₂ subtypes, with an EC₅₀ of 1.6nM at 5-HT_2A, vs 5.8nM at 5-HT_2C. It is structurally related to the psychedelic phenethylamines 2C-B and DOB, but with the amine side chain conformationally restricted as an azetidine ring.{{cite patent | url = https://patentimages.storage.googleapis.com/a2/12/19/8424e3822cbe82/US20210137908A1.pdf | inventor = Kristensen JL, Jensen AA, Märcher-Rørsted E | title = 5-HT2A Agonists for Use in Treatment of Depression. | country = US | number = 2021/0137908 | assign1 = Lophora ApS | pubdate = 13 May 2021 | postscript = . }}