Zolimidine

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444113320

| ImageFile = Zolimidine.svg

| ImageSize = 222

| ImageAlt = Skeletal formula of zolimidine

| ImageFile1 = Zolimidine 3D ball.png

| ImageSize1 = 240

| ImageAlt1 = Ball-and-stick model of the zolimidine molecule

| PIN = 2-[4-(Methanesulfonyl)phenyl]imidazo[1,2-a]pyridine

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 1222-57-7

| PubChem = 14652

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07075

| SMILES = CS(=O)(=O)C1=CC=C(C=C1)C2=CN3C=CC=CC3=N2

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 13985

| InChI = 1/C14H12N2O2S/c1-19(17,18)12-7-5-11(6-8-12)13-10-16-9-3-2-4-14(16)15-13/h2-10H,1H3

| InChIKey = VSLIUWLPFRVCDL-UHFFFAOYAK

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C14H12N2O2S/c1-19(17,18)12-7-5-11(6-8-12)13-10-16-9-3-2-4-14(16)15-13/h2-10H,1H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = VSLIUWLPFRVCDL-UHFFFAOYSA-N

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = YCF001N8QB

}}

|Section2={{Chembox Properties

| Formula = C₁₄H₁₂N₂O₂S

| MolarMass = 272.32 g/mol

| Appearance =

| Density = 1.31 g/cm³

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section6={{Chembox Pharmacology

| ATCCode_prefix = A02

| ATCCode_suffix = BX10

}}

|Section7={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Zolimidine (zoliridine, brand name Solimidin) is a gastroprotective{{cite journal|last1=Parisio|first1=C|last2=Clementi|first2=F|title=Surface Alterations Induced by Stress in Gastric Mucosa: Protective Effect of Zolimidine. A Transmission and Scanning Electron Microscope Investigation|journal=Laboratory Investigation|date=November 1976|volume=35|issue=5|pages=484–95|pmid=136548}} drug previously used for peptic ulcer{{cite journal|last1=Belohlavek|first1=D|last2=Malfertheiner|first2=P|title=The Effect of Zolimidine, Imidazopyridine-derivate, on the Duodenal Ulcer Healing|journal=Scandinavian Journal of Gastroenterology. Supplement|date=1979|volume=54|pages=44|pmid=161649}} and gastroesophageal reflux disease.{{cite journal|last1=Materia|first1=A|last2=Basso|first2=N|last3=Bagarani|first3=M|last4=Basoli|first4=A|last5=Speranza|first5=V|title=Treatment of Alkaline Reflux Gastritis with Zolimidine. Controlled Study|journal=La Clinica Terapeutica|date=30 April 1981|volume=97|issue=2|pages=183–91|pmid=6453678}}