Zorubicin
{{Short description|Chemical compound}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Drugbox
| verifiedrevid = 442303628
| IUPAC_name = (E)-N'-(1-((2S,4S)-4-((2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyltetrahydro-2H-pyran-2-yloxy)-2,5,12-trihydroxy-7-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-2-yl)ethylidene)benzohydrazide
| image = Zorubicin.png
| tradename = rubidazon, rubidazone
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status = Rx-only
| routes_of_administration = i.v.
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 54083-22-6
| ATC_prefix = L01
| ATC_suffix = DB05
| ATC_supplemental =
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB11618
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = V25F9362OP
| PubChem = 9595290
| ChemSpiderID = 7869436
| StdInChI = 1S/C34H35N3O10/c1-15-28(38)20(35)12-23(46-15)47-22-14-34(44,16(2)36-37-33(43)17-8-5-4-6-9-17)13-19-25(22)32(42)27-26(30(19)40)29(39)18-10-7-11-21(45-3)24(18)31(27)41/h4-11,15,20,22-23,28,38,40,42,44H,12-14,35H2,1-3H3,(H,37,43)/b36-16+/t15-,20-,22-,23-,28+,34-/m0/s1
| StdInChIKey = FBTUMDXHSRTGRV-ALTNURHMSA-N
| chemical_formula =
| C=34 | H=35 | N=3 | O=10
| smiles = OC1=C(C(C4=C(C=CC=C4OC)C3=O)=O)C3=C(O)C2=C1[C@@H](O[C@]5([H])O[C@@H](C)[C@@H](O)[C@@H](N)C5)C[C@@](/[C@@](C)=N/NC(C6=CC=CC=C6)=O)(O)C2
}}
Zorubicin (INN) is a benzoylhydrazone derivative of the anthracycline antineoplastic antibiotic daunorubicin. Zorubicin intercalates into DNA; it as well interacts with topoisomerase II and inhibits DNA polymerases and therefore is used to treat cancer.{{Cite web|url=https://drugs.ncats.io/drug/V25F9362OP|title=NCATS Inxight Drugs — ZORUBICIN|website=drugs.ncats.io}}{{cite journal | vauthors = Li X, Xu S, Tan Y, Chen J | title = The effects of idarubicin versus other anthracyclines for induction therapy of patients with newly diagnosed leukaemia | journal = The Cochrane Database of Systematic Reviews | volume = 2015 | issue = 6 | pages = CD010432 | date = June 2015 | pmid = 26037486 | pmc = 11218035 | doi = 10.1002/14651858.CD010432.pub2 }}
References
{{reflist}}
{{Chemotherapeutic agents}}
Category:Topoisomerase inhibitors
{{antineoplastic-drug-stub}}