abafungin

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477236893

| IUPAC_name = N-[4-[2-(2,4-dimethylphenoxy)phenyl]-1,3-thiazol-2-yl]-1,4,5,6-tetrahydropyrimidin-2-amine

| image = Abafungin.svg

| alt = Structural formula of abafungin

| width = 175

| image2 = Abafungin 3D spacefill.png

| alt2 = Space-filling model of the abafungin molecule

| width2 = 150

| tradename = Abasol

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Topical (cream)

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 129639-79-8

| ATC_prefix = none

| ATC_suffix =

| ATC_supplemental =

| PubChem = 159326

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 76005

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB06395

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 140124

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 11DI31LWXF

| chemical_formula =

| C=21 | H=22 | N=4 | O=1 | S=1

| smiles = CC1=CC(=C(C=C1)OC2=CC=CC=C2C3=CSC(=N3)NC4=NCCCN4)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C21H22N4OS/c1-14-8-9-18(15(2)12-14)26-19-7-4-3-6-16(19)17-13-27-21(24-17)25-20-22-10-5-11-23-20/h3-4,6-9,12-13H,5,10-11H2,1-2H3,(H2,22,23,24,25)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = TYBHXIFFPVFXQW-UHFFFAOYSA-N

}}

Abafungin (INN) is a broad-spectrum arylguanidines-class antifungal agent with a novel mechanism of action for the treatment of dermatomycoses.{{cite journal | vauthors = Borelli C, Schaller M, Niewerth M, Nocker K, Baasner B, Berg D, Tiemann R, Tietjen K, Fugmann B, Lang-Fugmann S, Korting HC | title = Modes of action of the new arylguanidine abafungin beyond interference with ergosterol biosynthesis and in vitro activity against medically important fungi | journal = Chemotherapy | volume = 54 | issue = 4 | pages = 245–259 | date = 2008 | pmid = 18587237 | pmc = 2818358 | doi = 10.1159/000142334 }}

Abasol is a topical cream formulation of abafungin by York Pharma.{{cite web | url = http://www.yorkpharma.com/media/YRK-Update_Abasol_061002-FN.pdf | publisher = York Pharma | title = Regulatory Update – Abasol | archive-url = https://web.archive.org/web/20070927102715/http://www.yorkpharma.com/media/YRK-Update_Abasol_061002-FN.pdf | archive-date=September 27, 2007 }}