abediterol
{{Short description|Chemical compound}}
{{Drugbox
| Watchedfields = changed
| verifiedrevid =
| IUPAC_name = 5-[(1R)-2-{[6-(2,2-Difluoro-2-phenylethoxy)hexyl]amino}-1-hydroxyethyl]-8-hydroxyquinolin-2(1H)-one
| image = Abediterol.svg
| width = 225
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| routes_of_administration = Inhalation
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| excretion =
| CAS_number = 915133-65-2
| ATC_prefix = None
| ATC_suffix =
| PubChem = 11962616
| IUPHAR_ligand = 9326
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10136846
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = QXA167CM6F
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D10219
| ChEBI = 142077
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 3039530
| C = 25
| H = 30
| F = 2
| N = 2
| O = 4
| smiles = FC(F)(c1ccccc1)COCCCCCCNC[C@H](O)c3ccc(O)c2c3\C=C/C(=O)N2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C25H30F2N2O4/c26-25(27,18-8-4-3-5-9-18)17-33-15-7-2-1-6-14-28-16-22(31)19-10-12-21(30)24-20(19)11-13-23(32)29-24/h3-5,8-13,22,28,30-31H,1-2,6-7,14-17H2,(H,29,32)/t22-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = SFYAXIFVXBKRPK-QFIPXVFZSA-N
}}
Abediterol (INN;{{cite journal|title=International Nonproprietary Names for Pharmaceutical Substances (INN). Proposed International Nonproprietary Names: List 104|journal=WHO Drug Information|date=2010|volume=24|issue=1|page=352|url=https://www.who.int/medicines/publications/druginformation/issues/PL-104.pdf|access-date=25 March 2016}} development codes AZD-0548 and LAS 100977) is a once-daily experimental drug candidate for the treatment of asthma and chronic obstructive pulmonary disease (COPD), but it has never been marketed.
History
Abediterol was under development by the Spanish pharmaceutical company Almirall and reached Phase II clinical trials,[http://www.almirall.com/webcorp2/cda/ImD_03_02.jsp Product development pipeline], Almirall{{cite web|title=AdisInsight: Abediterol|url=http://adisinsight.springer.com/drugs/800026746|website=Adis Insight|publisher=Springer International Publishing AG|access-date=25 March 2016}} but was discontinued in 2021.{{cite web | url = https://adisinsight.springer.com/drugs/800026746 | title = Abediterol |website=Adis Insight |publisher=Springer International Publishing AG |access-date= 6 February 2024}} Its coformulation with mometasone furoate also progressed to Phase II clinical trials, but was discontinued in 2019.{{cite web|title=AdisInsight: Abediterol/mometasone|url=http://adisinsight.springer.com/drugs/800033847|website=Adis Insight|publisher=Springer International Publishing AG |access-date= 6 February 2024}}
Mechanism of action
Abediterol is an ultra-long-acting β2 agonist (ultra-LABA).{{cite journal | vauthors = Beier J, Fuhr R, Massana E, Jiménez E, Seoane B, de Miquel G, Ruiz S | title = Abediterol (LAS100977), a novel long-acting β2-agonist: efficacy, safety and tolerability in persistent asthma | journal = Respiratory Medicine | volume = 108 | issue = 10 | pages = 1424–9 | date = October 2014 | pmid = 25256258 | doi = 10.1016/j.rmed.2014.08.005 | url = http://www.resmedjournal.com/article/S0954-6111(14)00287-X/pdf | doi-access = free }}{{Cite patent|number=WO2006122788A1|title=Derivatives of 4-(2-amino-1-hydroxyethyl)phenol as agonists of the β2 adrenergic receptor|gdate=2006-11-23|invent1=Duran|invent2=Crespo|invent3=Laria|invent4=Roig|inventor1-first=Carlos Puig|inventor2-first=Maria Isabel Crespo|inventor3-first=Julio Cesar Castro Palomino|inventor4-first=Silvia Gual|url=https://patents.google.com/patent/WO2006122788A1}}{{Cite patent|number=WO2010094484A1|title=5-(2-{[6-(2,2-difluoro-2-phenylethoxy)hexyl]amino}-l-hydroxyethyl)-8-hydroxyquinolin-2(1h)-one and its use in the treatment of pulmonary diseases|gdate=2010-08-26|invent1=Ruf|invent2=Montejo|inventor1-first=Thorsten|inventor2-first=Eric Massana|url=https://patents.google.com/patent/WO2010094484A1/en}}
References
{{reflist|2}}
{{Asthma and copd rx}}
{{Adrenergic receptor modulators}}
{{Muscarinic acetylcholine receptor modulators}}
Category:Long-acting beta2-adrenergic agonists
Category:Muscarinic antagonists
{{respiratory-system-drug-stub}}