ablukast

{{Short description|Chemical compound}}

{{Infobox drug

| verifiedrevid = 437130301

| IUPAC_name = 6-acetyl-7-[5-(4-acetyl-3-hydroxy-2-propylphenoxy)pentoxy]chroman-2-carboxylic acid

| image = Ablukast.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Investigational

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 96566-25-5

| CAS_supplemental =

| ATC_prefix = none

| ATC_suffix =

| ATC_supplemental =

| PubChem = 57109

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 51496

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 000TKM5BBQ

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02739

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 22016

| C=28 | H=34 | O=8

| smiles = CCCC1=C(C=CC(=C1O)C(=O)C)OCCCCCOC2=CC3=C(CCC(O3)C(=O)O)C=C2C(=O)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C28H34O8/c1-4-8-21-23(12-10-20(17(2)29)27(21)31)34-13-6-5-7-14-35-26-16-25-19(15-22(26)18(3)30)9-11-24(36-25)28(32)33/h10,12,15-16,24,31H,4-9,11,13-14H2,1-3H3,(H,32,33)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FGGYJWZYDAROFF-UHFFFAOYSA-N

}}

Ablukast (INN) is an experimental drug that is a leukotriene antagonist. It was investigated for potential applications in the treatment of inflammatory conditions, including asthma, skin disorders, and inflammatory bowel disease.{{cite journal | vauthors = Rosenbach T, Csatò M, Czarnetzki BM | title = Studies on the role of leukotrienes in murine allergic and irritant contact dermatitis | journal = The British Journal of Dermatology | volume = 118 | issue = 1 | pages = 1–6 | date = January 1988 | pmid = 2829957 | doi = 10.1111/j.1365-2133.1988.tb01743.x | s2cid = 1164113 }}{{cite web | url = https://adisinsight.springer.com/drugs/800002358 | title = Ablukast | publisher = Adis Insight }} It reached Phase III clinical trials, but development was discontinued in 1996.