abunidazole
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477237515
| ImageFile = Abunidazole.svg
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageSize = 200
| ImageName = Partially condensed, Kekulé, skeletal formula of abunidazole
| IUPACName = 4-tert-Butyl-2-[hydroxy-(1-methyl-5-nitroimidazol-2-yl)methyl]phenol
| Section1 = {{Chembox Identifiers
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = 91017-58-2
| PubChem = 170365
| ChemSpiderID = 148962
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChEMBL = 301926
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| SMILES = Cn1c(N(=O)=O)cnc1C(O)c2cc(C(C)(C)C)ccc2O
| StdInChI = 1S/C15H19N3O4/c1-15(2,3)9-5-6-11(19)10(7-9)13(20)14-16-8-12(17(14)4)18(21)22/h5-8,13,19-20H,1-4H3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| InChI = 1/C15H19N3O4/c1-15(2,3)9-5-6-11(19)10(7-9)13(20)14-16-8-12(17(14)4)18(21)22/h5-8,13,19-20H,1-4H3
| StdInChIKey = DBOZSKOENGSGEJ-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| InChIKey = DBOZSKOENGSGEJ-UHFFFAOYAQ
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 6EH821150I
}}
| Section2 = {{Chembox Properties
| C=15 | H=19 | N=3 | O=4
| LogP = 2.815
| pKa = 9.567
| pKb = 4.430
| Density = 1.303 g/mL
}}
}}
Abunidazole (INN) is a nitroimidazole antifungal medication.{{cite web|url=https://gsrs.ncats.nih.gov/app/substance/6EH821150I|title=Abunidazole|publisher=National Institutes of Health|accessdate=6 May 2021}} It was named in 1984{{cite journal|url=https://www.who.int/medicines/publications/druginformation/innlists/PL52.pdf|journal=WHO Chronicle|volume=38|issue=4|year=1984|title=International Nonproprietary Names for Pharmaceutical Substances – Proposed International Nonproprietary Names (Prop. INN): List 52|page=1}} but apparently never marketed.