acedapsone

{{Short description|Antimicrobial drug}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 477237907

| IUPAC_name = N-[4-(4-acetamidophenyl)sulfonylphenyl]acetamide

| image = Acedapsone.svg

| alt = Skeletal formula of acedapsone

| width = 250

| image2 = Acedapsone-3D-spacefill.png

| alt2 = Space-filling model of the acedapsone molecule

| width2 = 250

| tradename = Rodilone
Hansolar

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 77-46-3

| ATC_prefix = none

| ATC_suffix =

| ATC_supplemental =

| PubChem = 6477

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 6232

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0GZ72U84TN

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02751

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 154166

| chemical_formula =

| C=16 | H=16 | N=2 | O=4 | S=1

| smiles = CC(=O)NC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)NC(=O)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H16N2O4S/c1-11(19)17-13-3-7-15(8-4-13)23(21,22)16-9-5-14(6-10-16)18-12(2)20/h3-10H,1-2H3,(H,17,19)(H,18,20)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = AMTPYFGPPVFBBI-UHFFFAOYSA-N

| melting_point = 290

}}

Acedapsone (INN) is an antimicrobial drug, which also has antimalarial activity.

Acedapsone is the INN for diacetyldapsone. It was synthesized and developed in 1937 by Ernest Fourneau and his team in the pharmaceutical chemistry laboratory of Pasteur Institute,{{cite journal | vauthors = Fourneau E, Tréfouël J, Nitti F, Bovet D | author-link2 = Jacques Tréfouël | author-link4 = Daniel Bovet | title = Chimiothérapie de l'infection pneumococcique par la di-(p-acétylaminophényl)-sulfone (1399 F) | language = fr | journal = Compt. Rend. Acad. Sci. | date = July 1937 | volume = 205 | pages = 299 }} and it was marketed as Rodilone by the Rhône-Poulenc company.{{cite journal | vauthors = Fourneau JP | title = Ernest Fourneau, fondateur de la chimie thérapeutique française: feuillets d'album. | language = fr | journal = Revue d'Histoire de la Pharmacie | date = 1987 | volume = 75 | issue = 275 | pages = 335–55 | doi = 10.3406/pharm.1987.2904 }}

It is a long-acting prodrug of dapsone. It is used for treating leprosy.{{cite journal | vauthors = Shaw IN, Christian M, Jesudasan K, Kurian N, Rao GS | title = Effectiveness of multidrug therapy in multibacillary leprosy: a long-term follow-up of 34 multibacillary leprosy patients treated with multidrug regimens till skin smear negativity | journal = Leprosy Review | volume = 74 | issue = 2 | pages = 141–7 | date = June 2003 | doi = 10.47276/lr.74.2.141 | pmid = 12862255 | doi-access = free }}

It crystallises as pale yellow needles from diethyl ether, and as leaflets from dilute ethanol. It is slightly soluble in water.{{cn|date=January 2023}}