aceperone

{{Short description|Chemical compound}}

{{Drugbox

| drug_name =

| IUPAC_name = N-({1-[4-(4-Fluorophenyl)-4-oxobutyl]-4-phenyl-4-piperidinyl}methyl)acetamide

| image = Aceperone.svg

| width = 275

| alt =

| caption =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 807-31-8

| ATCvet =

| ATC_prefix = none

| ATC_suffix =

| UNII = S69KXZ59AB

| PubChem = 13122

| ChemSpiderID = 12570

| ChEMBL = 136298

| DrugBank =

| synonyms = Acetabuton; R 3248

| C=24 | H=29 | F=1 | N=2 | O=2

| smiles= Fc1ccc(cc1)C(=O)CCCN3CCC(c2ccccc2)(CC3)CNC(=O)C

| StdInChI = 1S/C24H29FN2O2/c1-19(28)26-18-24(21-6-3-2-4-7-21)13-16-27(17-14-24)15-5-8-23(29)20-9-11-22(25)12-10-20/h2-4,6-7,9-12H,5,8,13-18H2,1H3,(H,26,28)

| StdInChIKey = VDGZERMDPAAZEJ-UHFFFAOYSA-N

| melting_point = 97

| melting_high = 100

| melting_notes = {{cite patent | country = BE | number = 606849 | title = Alkoxylamino and alkoxycarbonylamino derivatives of 1(aroylalkyl)-4-arylpiperidines. | inventor = Janssen PA | pubdate = 1961 }}

}}

Aceperone is a neuroleptic drug of the butyrophenone class. It is an α-noradrenergic blocking drug developed by Janssen Pharmaceutica in the 1960s.

Aceperone has been used as a tool in the study of the biochemical basis of learning. Although aceperone does not block learning per se, it blocks access to an attentional mechanism by which animals ‘tune in’ to the relevant visual dimension when learning a visual discrimination task{{cite journal | vauthors = Ridley RM, Haystead TA, Baker HF, Crow TJ | title = A new approach to the role of noradrenaline in learning: problem-solving in the marmoset after alpha-noradrenergic receptor blockade | journal = Pharmacology, Biochemistry, and Behavior | volume = 14 | issue = 6 | pages = 849–55 | date = June 1981 | pmid = 6114497 | doi = 10.1016/0091-3057(81)90373-7 | s2cid = 35341802 }}{{cite journal | vauthors = Baker HF, Ridley RM, Haystead TA, Crow TJ | title = Further consideration of the learning impairment after aceperone in the marmoset: effects of the drug on shape and colour discrimination and on an alternation task | journal = Pharmacology, Biochemistry, and Behavior | volume = 18 | issue = 5 | pages = 701–4 | date = May 1983 | pmid = 6222386 | doi = 10.1016/0091-3057(83)90009-6 | s2cid = 7905046 }} at doses below those that affect general behaviour.{{cite journal | vauthors = Scraggs PR, Ridley RM | title = The effect of dopamine and noradrenaline blockade on amphetamine-induced behaviour in the marmoset | journal = Psychopharmacology | volume = 62 | issue = 1 | pages = 41–5 | date = March 1979 | pmid = 155838 | doi = 10.1007/BF00426033 | s2cid = 38197514 }}

References