acetophenazine

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 477239568

| IUPAC_name = 1-[10-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl]-10H-phenothiazin-2-yl]ethanone

| image = Acetophenazine.svg

| width = 250

| tradename =

| MedlinePlus = a600010

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 2751-68-0

| ATC_prefix = N05

| ATC_suffix = AB07

| PubChem = 17676

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01063

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 16708

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8620H6K4QH

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 2401

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1085

| KEGG = C06807

| C=23 | H=29

| N=3 | O=2

| S=1

| smiles = O=C(c2cc1N(c3c(Sc1cc2)cccc3)CCCN4CCN(CCO)CC4)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C23H29N3O2S/c1-18(28)19-7-8-23-21(17-19)26(20-5-2-3-6-22(20)29-23)10-4-9-24-11-13-25(14-12-24)15-16-27/h2-3,5-8,17,27H,4,9-16H2,1H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = WNTYBHLDCKXEOT-UHFFFAOYSA-N

}}

Acetophenazine (Tindal) is a typical antipsychotic of the phenothiazine class.{{cite book | url = https://books.google.com/books?id=AlFxWXBz9oIC&q=acetophenazine%20antipsychotic&pg=PA138 | title = Current Psychotherapeutic Drugs |via= Google Books| isbn = 978-0-88048-994-2 | vauthors = Quitkin FM | year = 1998 | publisher = American Psychiatric Pub }}