acetylcorynoline

{{Chembox

| ImageFile = Acetylcorynoline.svg

| ImageSize = 150px

| ImageAlt =

| SystematicName = (5bR,6S,12bR)-5b,13-Dimethyl-5b,6,7,12b,13,14-hexahydro-2H,10H-[1,3]benzodioxolo[5,6-c][1,3]dioxolo[4,5-i]phenanthridin-6-yl acetate

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 18797-80-3

| ChEBI = 188060

| ChEMBL = 4129674

| EC_number = 683-178-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 6ZFQ6Y9RZD

| PubChem = 177015

| InChI = 1S/C23H23NO6/c1-12(25)30-20-7-13-6-18-19(28-10-27-18)8-14(13)22-23(20,2)16-4-5-17-21(29-11-26-17)15(16)9-24(22)3/h4-6,8,20,22H,7,9-11H2,1-3H3/t20-,22+,23-/m0/s1

| InChIKey = PUHCFWFODBLSAP-WWNPGLIZSA-N

| SMILES = CC(=O)O[C@H]1CC2=CC3=C(C=C2[C@@H]4[C@]1(C5=C(CN4C)C6=C(C=C5)OCO6)C)OCO3

| ChemSpiderID = 154160

| InChI2 = 1/C23H23NO6/c1-12(25)30-20-7-13-6-18-19(28-10-27-18)8-14(13)22-23(20,2)16-4-5-17-21(29-11-26-17)15(16)9-24(22)3/h4-6,8,20,22H,7,9-11H2,1-3H3/t20-,22+,23-/m0/s1

| InChIKey2 = PUHCFWFODBLSAP-WWNPGLIZBS

}}

|Section2={{Chembox Properties

| C=23|H=23|N=1|O=6

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| GHS_ref=[https://pubchem.ncbi.nlm.nih.gov/compound/177015#section=Safety-and-Hazards]

| GHSPictograms = {{GHS06}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|300|330}}

| PPhrases = {{P-phrases|260|264|270|271|284|301+316|304+340|316|320|321|330|403+233|405|501}}

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Acetylcorynoline is a bio-active isolate of Corydalis ambigua. It inhibits the maturing of bone marrow-derived dendritic cells in mice. However, it is only cytotoxic in amounts of greater than 20 μM.{{cite journal | pmid = 23472193 | year = 2013 | last1 = Fu | first1 = RH | last2 = Wang | first2 = YC | last3 = Liu | first3 = SP | last4 = Chu | first4 = CL | last5 = Tsai | first5 = RT | last6 = Ho | first6 = YC | last7 = Chang | first7 = WL | last8 = Chiu | first8 = SC | last9 = Harn | first9 = HJ | last10 = Shyu | first10 = WC | last11 = Lin | first11 = SZ | title = Acetylcorynoline impairs the maturation of mouse bone marrow-derived dendritic cells via suppression of IκB kinase and mitogen-activated protein kinase activities | volume = 8 | issue = 3 | pages = e58398 | doi = 10.1371/journal.pone.0058398 | pmc = 3589392 | journal = PLOS ONE | bibcode = 2013PLoSO...858398F | editor1-last = Caldwell | editor1-first = Charles C| doi-access = free }}