acetyldigitoxin

{{Short description|Pharmaceutical drug}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 477240334

| IUPAC_name = [(2R,3R,4S,6S)-3-Hydroxy-6-[(2R,4S,6S)-4-hydroxy-6-[(2R,3S,4S,6R)-4-hydroxy-6-[ [(5R,8R,9S,10S,13R,14S,17R')-14-hydroxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]-2-methyloxan-3-yl]oxy-2-methyloxan-3-yl]oxy-2-methyloxan-4-yl] acetate

| image = Acetyldigitoxin.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 1111-39-3

| ATC_prefix = C01

| ATC_suffix = AA01

| PubChem = 68949

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00511

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4447572

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0ZV4Q4L2FU

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D06881

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 53773

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1200634

| C=43 | H=66 | O=14

| smiles = O=C\1OC/C(=C/1)[C@H]2CC[C@@]8(O)[C@]2(C)CC[C@H]7[C@H]8CC[C@H]6[C@]7(C)CC[C@H](O[C@@H]5O[C@@H]([C@@H](O[C@@H]4O[C@@H]([C@@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@@H](OC(=O)C)C3)[C@@H](O)C4)C)[C@@H](O)C5)C)C6

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C43H66O14/c1-21-38(48)33(54-24(4)44)19-37(51-21)57-40-23(3)53-36(18-32(40)46)56-39-22(2)52-35(17-31(39)45)55-27-9-12-41(5)26(16-27)7-8-30-29(41)10-13-42(6)28(11-14-43(30,42)49)25-15-34(47)50-20-25/h15,21-23,26-33,35-40,45-46,48-49H,7-14,16-20H2,1-6H3/t21-,22-,23-,26-,27+,28-,29+,30-,31+,32+,33+,35+,36+,37+,38-,39-,40-,41+,42-,43+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = HPMZBILYSWLILX-UMDUKNJSSA-N

}}

Acetyldigitoxin is a cardiac glycoside. It is an acetyl derivative of digitoxin, found in the leaves of Digitalis species.{{Cite journal| vauthors = Kemertelidze ÉP, Gvazava LN |date=1979-11-01|title=Odorobioside G from the leaves ofDigitalis ciliata|url=https://paperity.org/p/22594816/odorobioside-g-from-the-leaves-ofdigitalis-ciliata|journal=Chemistry of Natural Compounds|volume=15|issue=6|pages=779|doi=10.1007/BF00565608|doi-access=free}} It is used to treat cardiac failure, particularly that associated with tachycardia.{{cite journal | vauthors = Loffler W, Essellier AF, Forster G | title = Acetyl-digitoxin; clinical observations on the treatment of patients with advanced congestive heart failure | journal = American Heart Journal | volume = 47 | issue = 5 | pages = 898–911 | date = June 1954 | pmid = 13158272 | doi = 10.1016/0002-8703(54)90160-X }}

References

{{Cardiac glycosides}}

Category:Cardenolides

Category:Acetate esters

{{cardiovascular-drug-stub}}