acrivastine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 477241254

| IUPAC_name = (E)-3-{6-[(E)-1-(4-methylphenyl)-3-pyrrolidin-1-yl-
prop-1-enyl]pyridin-2-yl}prop-2-enoic acid

| image = Acrivastine.svg

| image_class = skin-invert-image

| tradename =

| Drugs.com = {{drugs.com|international|acrivastine}}

| pregnancy_AU =

| legal_AU =

| legal_CA =

| legal_UK = GSL

| legal_US = Rx-only

| routes_of_administration = By mouth

| elimination_half-life = 1.5 hours

| excretion = Kidney

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 87848-99-5

| ATC_prefix = R06

| ATC_suffix = AX18

| PubChem = 5284514

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4447574

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = A20F9XAI7W

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02760

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1224

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 83168

| C=22 | H=24 | N=2 | O=2

| smiles = O=C(O)\C=C\c3nc(\C(=C\CN1CCCC1)c2ccc(cc2)C)ccc3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C22H24N2O2/c1-17-7-9-18(10-8-17)20(13-16-24-14-2-3-15-24)21-6-4-5-19(23-21)11-12-22(25)26/h4-13H,2-3,14-16H2,1H3,(H,25,26)/b12-11+,20-13+

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = PWACSDKDOHSSQD-IUTFFREVSA-N

}}

Acrivastine is a medication used for the treatment of allergies and hay fever. It is a second-generation H1-receptor antagonist antihistamine (like its base molecule triprolidine) and works by blocking histamine H1 receptors.{{cite journal | vauthors = Brogden RN, McTavish D | title = Acrivastine. A review of its pharmacological properties and therapeutic efficacy in allergic rhinitis, urticaria and related disorders | journal = Drugs | volume = 41 | issue = 6 | pages = 927–40 | date = June 1991 | pmid = 1715267 | doi = 10.2165/00003495-199141060-00008 }}

This non-sedating{{verify source|date=November 2014}} antihistamine is sold under the brand name Benadryl Allergy Relief in the United Kingdom by McNeil Laboratories. It should not be confused with Benadryl Once a Day which has cetirizine as the active ingredient and is also sold by McNeil in the UK, nor with the American Benadryl, which uses diphenhydramine as its active ingredient. It is available as an over-the-counter medicine in the UK, and is available with or without pseudoephedrine under the Benadryl brand.

In the U.S., acrivastine was the active ingredient in Semprex-D. Semprex-D also contains the decongestant pseudoephedrine. Semprex-D was marketed in the U.S. by Actient Pharmaceuticals. Neither version of Semprex-D have been manufactured for sale in the US since 2008.[http://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?id=7627 SEMPREX-D - acrivastine and pseudoephedrine hydrochloride capsule] U.S. National Library of Medicine, National Institutes of Health, May 2008