adaprolol

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477242086

| IUPAC_name = (±)-2-(1-adamantyl)ethyl 2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetate

| image = Adaprolol.svg

| width = 290

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 101479-70-3

| ATC_prefix = none

| ATC_suffix =

| PubChem = 60732

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4940501

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = XP9911I1WL

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 435170

| C=26 | H=39 | N=1 | O=4

| smiles = O=C(CC1=CC=C(OCC(O)CNC(C)C)C=C1)OCCC23C[C@@H]4C[C@H](C2)C[C@H](C3)C4

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C26H39NO4/c1-18(2)27-16-23(28)17-31-24-5-3-19(4-6-24)12-25(29)30-8-7-26-13-20-9-21(14-26)11-22(10-20)15-26/h3-6,18,20-23,27-28H,7-17H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = IPGLIOFIFLXLKR-UHFFFAOYSA-N

}}

Adaprolol is a beta blocker.{{cite web | url = http://apps.who.int/medicinedocs/en/d/Js4895e/6.html | archive-url = https://web.archive.org/web/20120307220148/http://apps.who.int/medicinedocs/en/d/Js4895e/6.html | url-status = dead | archive-date = March 7, 2012 | title = The Use of Common Stems in the Selection of International Nonproprietary Names (INN) for Pharmaceutical Substances: Alphabetical list of stems together with corresponding INNs}}{{cite journal | vauthors = Boder N, Elkoussi A, Zuobi K, Kovacs P | title = Synthesis and pharmacological activity of adaprolol enantiomers: a new soft drug for treating glaucoma | journal = Journal of Ocular Pharmacology and Therapeutics | volume = 12 | issue = 2 | pages = 115–22 | date = 1996 | pmid = 8773927 | doi = 10.1089/jop.1996.12.115 }}