adenosine 3',5'-bisphosphate
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477242358
| ImageFile = Adenosin-3',5'-bisphosphat.svg
| ImageSize = 200px
| ImageAlt = Skeletal formula of adenosine 3',5'-bisphosphate
| ImageFile1 = Adenosine-3',5'-bisphosphate-anion-3D-spacefill.png
| ImageAlt1 = Space-filling model of the adenosine 3',5'-bisphosphate anion
| IUPACName = Adenosine 3′,5′-bis(dihydrogen phosphate)
| SystematicName = (2R,3S,4R,5R)-5-(6-Amino-9H-purin-9-yl)-4-hydroxy-2-[(phosphonooxy)methyl]oxolan-3-yl dihydrogen phosphate
| OtherNames = 3'-Phosphoadenylate
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 140102
| SMILES = c1nc(c2c(n1)n(cn2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)OP(=O)(O)O)O)N
| InChI = 1/C10H15N5O10P2/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7(25-27(20,21)22)4(24-10)1-23-26(17,18)19/h2-4,6-7,10,16H,1H2,(H2,11,12,13)(H2,17,18,19)(H2,20,21,22)/t4-,6-,7-,10-/m1/s1
| InChIKey = WHTCPDAXWFLDIH-KQYNXXCUBO
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C10H15N5O10P2/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7(25-27(20,21)22)4(24-10)1-23-26(17,18)19/h2-4,6-7,10,16H,1H2,(H2,11,12,13)(H2,17,18,19)(H2,20,21,22)/t4-,6-,7-,10-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = WHTCPDAXWFLDIH-KQYNXXCUSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo =1053-73-2
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = C65F80D52U
| PubChem = 159296
| IUPHAR_ligand = 1718
| MeSHName = Adenosine+bisphosphate
}}
| Section2 = {{Chembox Properties
| C=10 | H=15 | N=5 | O=10 | P=2
| MolarMass = 427.20 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Adenosine 3',5'-bisphosphate is a form of an adenosine nucleotide with two phosphate groups attached to different carbons in the ribose ring. This is distinct from adenosine diphosphate, where the two phosphate groups are attached in a chain to the 5' carbon atom in the ring.
Adenosine 3',5'-bisphosphate is produced as a product of sulfotransferase enzymes from the donation of a sulfate group from the coenzyme 3'-phosphoadenosine-5'-phosphosulfate.{{cite journal |vauthors =Negishi M, Pedersen LG, Petrotchenko E |title=Structure and function of sulfotransferases |journal=Arch. Biochem. Biophys. |volume=390 |issue=2 |pages=149–57 |year=2001 |pmid=11396917 |doi=10.1006/abbi.2001.2368|display-authors=etal|url=https://zenodo.org/record/1229406 }}{{cite journal |vauthors =Rath VL, Verdugo D, Hemmerich S |title=Sulfotransferase structural biology and inhibitor discovery |journal=Drug Discov. Today |volume=9 |issue=23 |pages=1003–11 |year=2004 |pmid=15574316 |doi=10.1016/S1359-6446(04)03273-8}} This product is then hydrolysed by 3'(2'),5'-bisphosphate nucleotidase to give adenosine monophosphate, which can then be recycled into adenosine triphosphate.{{cite journal | vauthors = Farooqui AA, Balasubramanian AS | date = 1970 | title = Enzymatic dephosphorylation 3'-phosphoadenosine 5'-phoaphosulfate to adenosine 5'-phosphosulfate in sheep brain | journal = Biochim. Biophys. Acta | volume = 198 | pages = 56–65 | pmid = 4313079 | issue = 1 | doi=10.1016/0005-2744(70)90032-x}}{{cite journal | vauthors = Ramaswamy SG, Jakoby WB | date = 1987 | title = (2')3',5'-Bisphosphate nucleotidase | journal = J. Biol. Chem. | volume = 262 | pages = 10044–7 | pmid = 3038862 | issue = 21 | doi = 10.1016/S0021-9258(18)61072-5 | doi-access = free }}