aderbasib

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| IUPAC_name = methyl (6S,7S)-7-(hydroxycarbamoyl)-6-[(4-phenyl-1-piperazinyl)carbonyl]-5-azaspiro[2.5]octane-5-carboxylate

| image = Aderbasib.svg

| alt = Skeletal formula of aderbasib

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Investigational

| routes_of_administration = Oral

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| smiles = COC(=O)N1CC2(CC2)C[C@@H]([C@H]1C(=O)N3CCN(CC3)C4=CC=CC=C4)C(=O)NO

| StdInChI = 1S/C21H28N4O5/c1-30-20(28)25-14-21(7-8-21)13-16(18(26)22-29)17(25)19(27)24-11-9-23(10-12-24)15-5-3-2-4-6-15/h2-6,16-17,29H,7-14H2,1H3,(H,22,26)/t16-,17-/m0/s1

| StdInChIKey = DJXMSZSZEIKLQZ-IRXDYDNUSA-N

| CAS_number = 791828-58-5

| ATCvet =

| ATC_prefix = None

| ATC_suffix =

| PubChem = 16070111

Q03790

| KEGG = D09320

Q03790

| ChEMBL = 2103790

| UNII = V9YL6NEJ3G

| DrugBank =

| ChemSpiderID = 17229620

| C=21|H=28|N=4|O=5

}}

Aderbasib (codenamed INCB7839) is a sheddase inhibitor that may suppress tumor cell proliferation.{{cite web|url=http://www.ama-assn.org/resources/doc/usan/aderbasib.pdf|title=STATEMENT ON A NONPROPRIETARY NAME ADOPTED BY THE USAN COUNCIL|publisher=Ama-assn.org|accessdate=2012-10-13}} Acting on multiple receptor classes and subclasses, aderbasib is observed to regulate the tumor necrosis factor of cancer cells.{{cite web|url=http://www.medkoo.com/Anticancer-trials/Aderbasib.htm |title=Aderbasib | CAS#791828-58-5 |publisher=MedKoo |date= |accessdate=2012-10-13}}

Aderbasib was being developed by Incyte as a potential adjunctive treatment for metastatic breast cancer. Development was halted in 2011 after positive findings from Phase II trials were contradicted by further research.{{cite web |url=http://phx.corporate-ir.net/External.File?item=UGFyZW50SUQ9NDQwNjgzfENoaWxkSUQ9NDYyNTAzfFR5cGU9MQ==&t=1 |title=UBS 2011 Global Life Sciences Conference |author=Incyte |author-link=Incyte |date=2011-09-19 |accessdate=2013-02-13}}{{cite press release |url=http://www.thestreet.com/story/11290594/1/incyte-reports-third-quarter-2011-financial-results-and-provides-update-on-key-clinical-programs.html |title=Incyte Reports Third Quarter 2011 Financial Results And Provides Update On Key Clinical Programs |date=2011-10-27 |publisher=BusinessWire |accessdate=2013-02-13}}

More specifically, aderbasib is an inhibitor of ADAM10 and ADAM17.{{cite journal | vauthors = Yang L, Bhattacharya A, Li Y, Sexton S, Ling X, Li F, Zhang Y | title = Depleting receptor tyrosine kinases EGFR and HER2 overcomes resistance to EGFR inhibitors in colorectal cancer | journal = Journal of Experimental & Clinical Cancer Research | volume = 41 | issue = 1 | pages = 184 | date = June 2022 | pmid = 35650607 | pmc = 9161494 | doi = 10.1186/s13046-022-02389-z | doi-access = free | url = }}