ageliferin
{{Chembox
|Verifiedfields = changed
|Watchedfields = changed
|verifiedrevid = 477243588
|ImageFile = Ageliferin.png
|ImageSize = 200px
|PIN = N,N′-
|OtherNames = Ageliferine
|Section1={{Chembox Identifiers
|ChEMBL_Ref = {{ebicite|changed|EBI}}
|ChEMBL = 502866
|PubChem = 11169518
|ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
|ChemSpiderID = 9344613
|SMILES = C1[C@@H]([C@H]([C@@H](C2=C1NC(=N2)N)C3=CN=C(N3)N)CNC(=O)C4=CC(=CN4)Br)CNC(=O)C5=CC(=CN5)Br
|InChI = 1/C22H24Br2N10O2/c23-10-2-14(27-5-10)19(35)29-4-9-1-13-18(34-22(26)32-13)17(16-8-31-21(25)33-16)12(9)7-30-20(36)15-3-11(24)6-28-15/h2-3,5-6,8-9,12,17,27-28H,1,4,7H2,(H,29,35)(H,30,36)(H3,25,31,33)(H3,26,32,34)/t9-,12-,17-/m1/s1
|InChIKey = DMMLTRAQSJWUHT-OGTWGDGJBG
|StdInChI_Ref = {{stdinchicite|changed|chemspider}}
|StdInChI = 1S/C22H24Br2N10O2/c23-10-2-14(27-5-10)19(35)29-4-9-1-13-18(34-22(26)32-13)17(16-8-31-21(25)33-16)12(9)7-30-20(36)15-3-11(24)6-28-15/h2-3,5-6,8-9,12,17,27-28H,1,4,7H2,(H,29,35)(H,30,36)(H3,25,31,33)(H3,26,32,34)/t9-,12-,17-/m1/s1
|StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
|StdInChIKey = DMMLTRAQSJWUHT-OGTWGDGJSA-N
|CASNo_Ref = {{cascite|changed|??}}
|CASNo = 117417-64-8
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = P4YF5N7VXX
}}
|Section2={{Chembox Properties
|C=22 | H=24 | Br=2 | N=10 | O=2
}}
}}
Ageliferin is a chemical compound produced by some sponges. It was first isolated from Caribbean and then Okinawan marine sponges in the genus Agelas.{{cite journal |author= Rinehart, Kenneth L |title= Bioactive Compounds from Aquatic and Terrestrial Sources |journal= Journal of Natural Products |year= 1990 |volume= 53 |issue= 4 |pages= 771–792 |doi= 10.1021/np50070a001|pmid= 2095373 |display-authors=etal}}{{cite journal |author= Keifer, Paul A. |title= Bioactive Bromopyrrole Metabolites from the Caribbean Sponge Agelas conifera |journal= J. Org. Chem. |year= 1991 |volume= 56 |issue= 9 |pages= 2965–75 |doi= 10.1021/jo00009a008|display-authors=etal}}{{cite journal |author= Kobayashi, Junichi |title= Ageliferins, potent actomyosin ATPase activators from the Okinawan marine sponge Agelas sp. |journal= Tetrahedron |year= 1990 |volume= 46 |issue= 16 |pages= 5579–86 |doi= 10.1016/S0040-4020(01)87756-5|display-authors=etal}} It often co-exists with the related compound sceptrin and other similar compounds. It has antibacterial properties and can cause biofilms to dissolve.{{cite journal |title= Sponge's secret weapon restores antibiotics' power: Bacteria treated with compound lose their resistance |journal= Science News |author= Laura Sanders |year= 2009 |volume= 175 |issue= 6 |pages= 16 |url= http://www.sciencenews.org/view/generic/id/40894/title/Sponge%27s_secret_weapon_restores_antibiotics%27_power |doi=10.1002/scin.2009.5591750616}}