albaconazole

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 437205813

| IUPAC_name = 7-Chloro-3-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]quinazolin-4-one

| image = Albaconazole.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 187949-02-6

| ATC_prefix = none

| ATC_suffix =

| ATC_supplemental =

| PubChem = 208952

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 181045

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = YDW24Y8IAB

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D09702

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 298817

| chemical_formula =

| C=20 | H=16 | Cl=1 | F=2 | N=5 | O=2

| smiles = Fc1ccc(c(F)c1)[C@](O)([C@H](N3\C=N/c2cc(Cl)ccc2C3=O)C)Cn4ncnc4

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C20H16ClF2N5O2/c1-12(28-11-25-18-6-13(21)2-4-15(18)19(28)29)20(30,8-27-10-24-9-26-27)16-5-3-14(22)7-17(16)23/h2-7,9-12,30H,8H2,1H3/t12-,20-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = UHIXWHUVLCAJQL-MPBGBICISA-N

}}

Albaconazole (development code UR-9825) is an experimental triazole antifungal.{{cite web | url = https://adisinsight.springer.com/drugs/800009452 | title = Albaconazole | work = Adis Insight | publisher = Springer Nature Switzerland AG }} It has potential broad-spectrum activity. The drug blocks a number of CYP450 liver enzymes.{{cn|date=December 2022}}

It has also been studied as an antiprotozoal agent.{{cite journal | vauthors = Guedes PM, Urbina JA, de Lana M, Afonso LC, Veloso VM, Tafuri WL, Machado-Coelho GL, Chiari E, Bahia MT | display-authors = 6 | title = Activity of the new triazole derivative albaconazole against Trypanosoma (Schizotrypanum) cruzi in dog hosts | journal = Antimicrobial Agents and Chemotherapy | volume = 48 | issue = 11 | pages = 4286–92 | date = November 2004 | pmid = 15504854 | pmc = 525424 | doi = 10.1128/AAC.48.11.4286-4292.2004 }}