aleglitazar

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477246742

| ImageFile = Aleglitazar.svg

| ImageSize = 200px

| PIN = (2S)-2-Methoxy-3-{4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-1-benzothiophen-7-yl}propanoic acid

| OtherNames = Ro-0728804, R-1439

|Section1={{Chembox Identifiers

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 41T4OAG59U

| IUPHAR_ligand = 7405

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 8450255

| InChI = 1/C24H23NO5S/c1-15-19(25-23(30-15)16-6-4-3-5-7-16)10-12-29-20-9-8-17(14-21(28-2)24(26)27)22-18(20)11-13-31-22/h3-9,11,13,21H,10,12,14H2,1-2H3,(H,26,27)/t21-/m0/s1

| InChIKey = DAYKLWSKQJBGCS-NRFANRHFBF

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 519504

| SMILES1 = O=C(O)[C@@H](OC)Cc4ccc(OCCc1nc(oc1C)c2ccccc2)c3c4scc3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C24H23NO5S/c1-15-19(25-23(30-15)16-6-4-3-5-7-16)10-12-29-20-9-8-17(14-21(28-2)24(26)27)22-18(20)11-13-31-22/h3-9,11,13,21H,10,12,14H2,1-2H3,(H,26,27)/t21-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = DAYKLWSKQJBGCS-NRFANRHFSA-N

| CASNo_Ref = {{cascite|changed|??}}

| CASNo=475479-34-6

| PubChem=10274777

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D08845

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB08915

| SMILES=CC1=C(CCOc2ccc(C[C@H](OC)C(O[H])=O)c3c2C=CS3)N=C(c4ccccc4)O1

}}

|Section2={{Chembox Properties

| C=24 | H=23 | N=1 | O=5 | S=1

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Aleglitazar is a peroxisome proliferator-activated receptor agonist (hence a PPAR modulator) with affinity to PPARα and PPARγ, which was under development by Hoffmann–La Roche for the treatment of type II diabetes.{{cite web | url = http://www.ama-assn.org/ama1/pub/upload/mm/365/aleglitazar.pdf | title = Statement on a nonproprietary name adopted by the USAN Council: Aleglitazar | work = United States Adopted Names | publisher = American Medical Association | access-date = 2008-08-17}} It is no longer in phase III clinical trials.{{cite news | url = https://www.reuters.com/article/us-roche-idUSBRE96903Z20130710| title = Roche halts diabetes drug trial in blow to pipeline | access-date = 2013-07-10| date = 2013-07-10| publisher = Roche }}