allose
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477318076
| Reference = {{Merck11th}}
| ImageFile = Allose.png
| ImageName = Stereo structural formula of (6R)-allopyranose
| ImageFile1 = Alpha allose ball-and-stick.png
| ImageName1 = Ball-and-stick model of Alpha-allose (D, L)
| IUPACName = allo-Hexosehttps://iupac.qmul.ac.uk/2carb/app.html
| PIN = Allose
| SystematicName = (2R,3R,4R,5R)-2,3,4,5,6-Pentahydroxyhexanal
| Section1 = {{Chembox Identifiers
| CASNo = 2595-97-3
| CASNo_Comment = (D)
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 7635-11-2
| CASNo1_Comment = (L)
| CASNo1_Ref = {{cascite|correct|??}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = SV1ATP0KYY
| UNII_Comment = (D)
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| PubChem = 102288
| ChemSpiderID = 92408
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 40822
| SMILES = OCC(O)[C@@H](O)[C@@H](O)[C@@H](O)C=O
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4?,5-,6+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = GZCGUPFRVQAUEE-OBOOZECYSA-N}}
| Section2 = {{Chembox Properties
| C=6 | H=12 | O=6
| MeltingPtC = 128}}
}}
Allose is an aldohexose sugar. It is a rare monosaccharide that occurs as a 6-O-cinnamyl glycoside in the leaves of the African shrub Protea rubropilosa. Extracts from the fresh-water alga Ochromas malhamensis contain this sugar but of unknown absolute configuration. It is soluble in water and practically insoluble in methanol.{{Citation needed|date=March 2025|reason=Claim for physical property should be supported by experimental results.}}
Reduction of allose by catalytic hydrogenation produces an obscure sugar alcohol allitol which is rarely used in the chemical industry.{{cite web |last=Reusch |first=William |date=May 5, 2013 |title=Carbohydrates |url= https://www2.chemistry.msu.edu/faculty/reusch/virttxtjml/carbhyd.htm |website=chemistry.msu.edu |location=East Lansing, Michigan |publisher=Michigan State University |access-date=January 21, 2025}}National Center for Biotechnology Information (2025). PubChem Compound Summary for CID 120700, Allitol. Retrieved January 21, 2025 from [https://pubchem.ncbi.nlm.nih.gov/compound/Allitol Allitol].
Notes
{{reflist}}
References
- Carbohydrates, edited by P.M. Collins, Chapman and Hall, {{ISBN|0-412-26960-0}}
{{Carbohydrates}}
{{Ether-stub}}