almestrone
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = (7R,8R,9S,13S,14S)-3-hydroxy-7,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one
| image = Almestrone.svg
| width = 225px
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = By mouth
| class = Estrogen
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref =
| CAS_number = 10448-96-1
| CAS_supplemental =
| ATC_prefix = None
| ATC_suffix =
| PubChem = 65601
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 59042
| ChEMBL = 2104052
| UNII = N18A31MTB0
| synonyms = Ba 38372; Ciba 38372; 7α-Methylestrone
| C=19 | H=24 | O=2
| SMILES = CC1CC2=C(C=CC(=C2)O)C3C1C4CCC(=O)C4(CC3)C
| StdInChI_Ref =
| StdInChI = InChI=1S/C19H24O2/c1-11-9-12-10-13(20)3-4-14(12)15-7-8-19(2)16(18(11)15)5-6-17(19)21/h3-4,10-11,15-16,18,20H,5-9H2,1-2H3/t11-,15-,16+,18-,19+/m1/s1
| StdInChIKey_Ref =
| StdInChIKey = JUAJXSMWFOFDFC-MNHDCVOLSA-N
}}
Almestrone ({{abbrlink|INN|International Nonproprietary Name}}) (developmental code names Ba 38372, Ciba 38372), also known as 7α-methylestrone, is a synthetic, steroidal estrogen which was synthesized in 1967 but was never marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA900|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=900–}} It is used as a precursor in the synthesis of several highly active steroids.{{cite book| vauthors = Krause N, Aksin-Artok Ö |title=PATai's Chemistry of Functional Groups|chapter=Copper-Mediated and Copper-Catalyzed Addition and Substitution Reactions of Extended Multiple Bond Systems|year=2011|doi=10.1002/9780470682531.pat0450|isbn=9780470682531}}{{cite journal| vauthors = Morais GR, Yoshioka N, Watanabe M, Mataka S, Oliveira CD, Thiemann T |title=C7-Substituted Estranes and Related Steroids|journal=Mini-Reviews in Organic Chemistry|volume=3|issue=3|year=2006|pages=229–251|issn=1570-193X|doi=10.2174/1570193X10603030229}}
See also
References
{{Reflist}}
{{Estrogen receptor modulators}}
{{Steroid-stub}}
{{Genito-urinary-drug-stub}}