almokalant

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 453369718

| IUPAC_name = 4-(3-{Ethyl[3-(propane-1-sulfinyl)propyl]amino}-2-hydroxypropoxy)benzonitrile

| image = almokalant.svg

| alt =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 123955-10-2

| ATCvet =

| ATC_prefix = None

| ATC_suffix =

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = I9NG89L275

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 362103

| PubChem = 3033962

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 2298526

| smiles = O=S(CCC)CCCN(CC)CC(O)COc1ccc(C#N)cc1

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H28N2O3S/c1-3-11-24(22)12-5-10-20(4-2)14-17(21)15-23-18-8-6-16(13-19)7-9-18/h6-9,17,21H,3-5,10-12,14-15H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = ZMHOBBKJBYLXFR-UHFFFAOYSA-N

| C=18 | H=28 | N=2 | O=3 | S=1

}}

Almokalant is a drug used to treat arrhythmia.{{cite journal | vauthors = Wiesfeld AC, Crijns HJ, Bergstrand RH, Almgren O, Hillege HL, Lie KI | title = Torsades de pointes with Almokalant, a new class III antiarrhythmic drug | journal = American Heart Journal | volume = 126 | issue = 4 | pages = 1008–1011 | date = October 1993 | pmid = 8213422 | doi = 10.1016/0002-8703(93)90726-p }} It is a potassium channel blocker. It has been found to have teratogenic effects in rats.{{cite journal | vauthors = Wellfelt K, Sköld AC, Wallin A, Danielsson BR | title = Teratogenicity of the class III antiarrhythmic drug almokalant. Role of hypoxia and reactive oxygen species | journal = Reproductive Toxicology | volume = 13 | issue = 2 | pages = 93–101 | date = 1999-04-01 | pmid = 10213516 | doi = 10.1016/s0890-6238(98)00066-5 | bibcode = 1999RepTx..13...93W }}