aloxiprin

{{Drugbox

| verifiedrevid = 447907078

| IUPAC_name = aluminium 2-acetyloxybenzoate hydroxide

| image = Aloxiprin.png

| image_class = skin-invert-image

| tradename =

| Drugs.com = {{drugs.com|international|aloxiprin}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 9014-67-9

| ATC_prefix = B01

| ATC_suffix = AC15

| ATC_supplemental = {{ATC|N02|BA02}}

| PubChem = 71586929

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 32698107

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 6QT214X4XU

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07421

| C = 9

| H = 8

| Al = 2

| O = 7

| SMILES = CC(=O)OC1=CC=CC=C1C(=O)O.[O-2].[O-2].[O-2].[Al+3].[Al+3]

| SMILES2 = CC(=O)Oc0ccccc0C(=O)O[Al](O)OC(=O)c1ccccc1OC(=O)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C9H8O4.2Al.3O/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;;;;;/h2-5H,1H3,(H,11,12);;;;;/q;2*+3;3*-2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = MXCPYJZDGPQDRA-UHFFFAOYSA-N

}}

Aloxiprin (or aluminium acetylsalicylate) is a medical drug used for the treatment of pain and inflammation associated with muscular skeletal and joint disorders.

It is used for its properties as an anti-inflammatory, antipyretic and analgesic drug.{{cite web |last=MIMS |title=Aloxiprin |url=http://www.mimsonline.com/USA/drug/info/aloxiprin?type=brief&h=nonsteroidal,anti,inflammatory,drugs,nsaids |access-date=16 April 2011 |work=MIMS}}

It is a chemical compound of aluminium hydroxide and aspirin.{{cite web|last=Encarta|title=Aloxiprin|url=http://uk.encarta.msn.com/dictionary_1481579253_1861822000/prevpage.html|work=Encarta|access-date=16 April 2011}}{{Dead link|date=October 2018 |bot=InternetArchiveBot |fix-attempted=yes }}{{cite journal |vauthors =CUMMINGS AJ, MARTIN BK, WIGGINS LF |title=In vitro and in vivo properties of aloxiprin: a new aluminium derivative of acetylsalicylic acid |journal=J. Pharm. Pharmacol. |volume=15 |pages=56–62 |year=1963 |pmid=14024235 |doi=10.1111/j.2042-7158.1963.tb12743.x|s2cid=33366977 }}

Alternative names and combinations

Palaprin Forte{{cite journal |author =Geller J |title=A comparative trial of aloxiprin ('Palaprin Forte') and phenylbutazone ('Butazolidin') |journal=The British Journal of Clinical Practice |volume=22 |issue=9 |pages=392–4 |year=1968 |pmid=4876729 }}
Askit Powders - A powder combination of aspirin, aloxiprin and caffeine.{{cite web|author=Net Doctor UK|title=Askit Powders|url=http://www.netdoctor.co.uk/medicines/100000180.html|work=Treatments for joint, muscle and bone conditions|access-date=16 April 2011}}

Contraindications

People with allergies to salicylates.
People with gastrointestinal ulcers.
People with liver or kidney damage.
Pregnant women in the 3rd trimester.
Women who are breastfeeding.
Use with other salicylates.
Use with NSAIDs.

References

External links

[http://ctd.mdibl.org/detail.go?type=chem&acc=C0108437 CTD's Aloxiprin page]{{Dead link|date=October 2018 |bot=InternetArchiveBot |fix-attempted=yes }} from the Comparative Toxicogenomics Database

Category:Antiplatelet drugs

Category:Acetylsalicylic acids

Category:Aluminium compounds