amedalin
{{Short description|Group of stereoisomers}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 451564692
| IUPAC_name = 3-Methyl-3-[3-(methylamino)propyl]-1-phenyl-1,3-dihydro-2H-indol-2-one
| image = Amedalin.svg
| tradename =
| pregnancy_category =
| legal_status =
| routes_of_administration =
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 22136-26-1
| CAS_supplemental =
{{CAS|22232-73-1}} (HCl)
| ATC_prefix = None
| ATC_suffix =
| PubChem = 31075
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 28832
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 2110769
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 2OWK6X9N16
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = D02891
| C=19 | H=22 | N=2 | O=1
| smiles = CC1(C2=CC=CC=C2N(C1=O)C3=CC=CC=C3)CCCNC
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H22N2O/c1-19(13-8-14-20-2)16-11-6-7-12-17(16)21(18(19)22)15-9-4-3-5-10-15/h3-7,9-12,20H,8,13-14H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = HBGWAZBZXJBYQD-UHFFFAOYSA-N
}}
Amedalin (UK-3540-1) is an antidepressant which was synthesized in the early 1970s but was never marketed.{{cite book | first = David J. | last = Triggle | name-list-style = vanc | title = Dictionary of pharmacological agents | publisher = Chapman & Hall | location = London | year = 1997 | isbn = 978-0-412-46630-4 | url = https://books.google.com/books?id=DeX7jgInYFMC&q=amedalin&pg=PA65}}{{cite journal | vauthors = Cañas-Rodriguez A, Leeming PR | title = N-Phenyl-2-indolinones and N-phenylindolines. A new class of antidepressant agents | journal = Journal of Medicinal Chemistry | volume = 15 | issue = 7 | pages = 762–70 | date = July 1972 | pmid = 5043876| doi = 10.1021/jm00277a017 }} It is a selective norepinephrine reuptake inhibitor, with no significant effects on the reuptake of serotonin and dopamine, and no antihistamine or anticholinergic properties.{{cite journal | vauthors = Koe BK | title = Molecular geometry of inhibitors of the uptake of catecholamines and serotonin in synaptosomal preparations of rat brain | journal = Journal of Pharmacology and Experimental Therapeutics | volume = 199 | issue = 3 | pages = 649–661 |date=December 1976 | doi = 10.1016/S0022-3565(25)30726-3 | pmid = 994022| url = http://jpet.aspetjournals.org/content/199/3/649.abstract| url-access = subscription }}
See also
References
{{Reflist}}
{{Antidepressants}}
{{Monoamine reuptake inhibitors}}
Category:Norepinephrine reuptake inhibitors
{{Amine-stub}}
{{nervous-system-drug-stub}}