amfenac

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 443210988

| IUPAC_name = (2-Amino-3-benzoylphenyl)acetic acid

| image = Amfenac.svg

| image_class = skin-invert-image

| width = 199

| tradename =

| pregnancy_AU =

| pregnancy_US =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| excretion =

| IUPHAR_ligand = 7565

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 51579-82-9

| ATC_prefix = none

| ATC_suffix =

| PubChem = 2136

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 75915

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 2051

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 28O5C1J38A

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07443

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 25146

| C=15 | H=13 | N=1 | O=3

| smiles = O=C(c1cccc(c1N)CC(=O)O)c2ccccc2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C15H13NO3/c16-14-11(9-13(17)18)7-4-8-12(14)15(19)10-5-2-1-3-6-10/h1-8H,9,16H2,(H,17,18)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = SOYCMDCMZDHQFP-UHFFFAOYSA-N

}}

Amfenac, also known as 2-amino-3-benzoylbenzeneacetic acid, is a nonsteroidal anti-inflammatory drug (NSAID) with acetic acid moiety.{{cite journal | vauthors = Hiranuma T, Kato S, Hachisu M | title = Analgesic action of amfenac Na, a non-steroidal anti-inflammatory agent | journal = Journal of Pharmacobio-Dynamics| volume = 11 | issue = 9 | pages = 612–9 | date = September 1988 | pmid = 3265150 | doi = 10.1248/bpb1978.11.612 | doi-access = free }}