amflutizole

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 451559560

| IUPAC_name = 4-Amino-3-[3-(trifluoromethyl)phenyl]-1,2-thiazole-5-carboxylic acid

| image = Amflutizole Structure.svg

| tradename =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 82114-19-0

| ATC_prefix = none

| ATC_suffix =

| ChEMBL = 2106558

| PubChem = 54833

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 49508

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 83N680M457

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02896

| C=11 | H=7 | F=3 | N=2 | O=2 | S=1

| smiles = FC(F)(F)c1cccc(c1)c2nsc(c2N)C(=O)O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C11H7F3N2O2S/c12-11(13,14)6-3-1-2-5(4-6)8-7(15)9(10(17)18)19-16-8/h1-4H,15H2,(H,17,18)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = KVMCEGAWQYTFKC-UHFFFAOYSA-N

}}

Amflutizole is a xanthine oxidase inhibitor{{cite journal | vauthors = O'Regan MH, Smith-Barbour M, Perkins LM, Cao X, Phillis JW | title = The effect of amflutizole, a xanthine oxidase inhibitor, on ischemia-evoked purine release and free radical formation in the rat cerebral cortex | journal = Neuropharmacology | volume = 33 | issue = 10 | pages = 1197–201 | date = October 1994 | pmid = 7862255 | doi = 10.1016/S0028-3908(05)80010-3 | s2cid = 37262919 }} used for the treatment of gout.