amfonelic acid

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477001303

| IUPAC_name = 7-benzyl-1-ethyl-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid

| image = Amfonelic_acid.png

| image_class = skin-invert-image

| tradename =

| legal_status = Uncontrolled

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 15180-02-6

| ATC_prefix = none

| ATC_suffix =

| PubChem = 2137

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 2052

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = RR302AR19Y

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02897

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 35337

| C=18 | H=16 | N=2 | O=3

| smiles = CCN1C=C(C(=O)C2=C1N=C(C=C2)CC3=CC=CC=C3)C(=O)O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H16N2O3/c1-2-20-11-15(18(22)23)16(21)14-9-8-13(19-17(14)20)10-12-6-4-3-5-7-12/h3-9,11H,2,10H2,1H3,(H,22,23)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = WHHHJDGNBVQNAU-UHFFFAOYSA-N

|drug_name=|alt=|caption=|type=|MedlinePlus=|licence_EU=|pregnancy_AU=|pregnancy_US=|pregnancy_category=|licence_US=|DrugBank=}}

Amfonelic acid (AFA; WIN 25,978) is a research chemical and dopaminergic stimulant with antibiotic properties. Limited clinical trials have been conducted, and it is primarily used in scientific research.{{cite magazine|url=http://harpers.org/archive/2015/10/sad-pink-monkey-blues/ |title=Sad Pink Monkey Blues | last = Morris | first = Hamilton |magazine=Harper's Magazine |date=October 2015 |access-date=2015-09-19}}

History

The stimulant properties of AFA were discovered incidentally at Sterling-Winthrop during research on the antibiotic nalidixic acid. In addition to behaving as an antibiotic, it was found that many derivatives of nalidixic acid have either stimulant or depressant effects on the central nervous system.{{ cite patent | country = US | status = patent | number = 3590036 | title = Naphthyridine-3-carboxylic Acids, Their Derivatives and Preparation Thereof }} Researchers at Sterling-Winthrop found that AFA had a higher potency and therapeutic index than cocaine or amphetamine, leading to further study of the drug.{{cite journal | vauthors = Aceto MD, Botton I, Martin R, Levitt M, Bentley HC, Speight PT | title = Pharmacologic properties and mechanism of action of amfonelic acid | journal = European Journal of Pharmacology | volume = 10 | issue = 3 | pages = 344–54 | year = 1970 | pmid = 4393073 | doi = 10.1016/0014-2999(70)90206-2 }} A small number of clinical trials were held in the 1970s, but clinical evaluation of AFA was discontinued after it was found that AFA exacerbated psychotic symptoms in schizophrenic patients and produced undesirable stimulant properties in geriatric depressives. AFA remains a widely used pharmacological tool for study of the brain's reward system, dopamine pathways, and the dopamine transporter. Since 2013, AFA has been sold on the gray market and there are numerous anecdotal reports detailing its non-medical use.

Pharmacology

In studies, it proved to be a potent and highly selective dopamine reuptake inhibitor (DRI) in rat brain preparations.{{cite journal | vauthors = Fuller RW, Perry KW, Bymaster FP, Wong DT | title = Comparative effects of pemoline, amfonelic acid and amphetamine on dopamine uptake and release in vitro and on brain 3,4-dihydroxyphenylacetic acid concentration in spiperone-treated rats | journal = The Journal of Pharmacy and Pharmacology | volume = 30 | issue = 3 | pages = 197–8 | date = March 1978 | pmid = 24701 | doi = 10.1111/j.2042-7158.1978.tb13201.x | s2cid = 28881012 }}{{cite journal | vauthors = McMillen BA, Shore PA | title = Amfonelic acid, a non-amphetamine stimulant, has marked effects on brain dopamine metabolism but not noradrenaline metabolism: association with differences in neuronal storage systems | journal = The Journal of Pharmacy and Pharmacology | volume = 30 | issue = 7 | pages = 464–6 | date = July 1978 | pmid = 27622 | doi = 10.1111/j.2042-7158.1978.tb13293.x | s2cid = 34793566 }} A study found a moderately long half-life of approximately 12 hours and a dopaminergic potency approximately 50 fold that of methylphenidate in rat brain preparations.{{cite journal | vauthors = Izenwasser S, Werling LL, Cox BM | title = Comparison of the effects of cocaine and other inhibitors of dopamine uptake in rat striatum, nucleus accumbens, olfactory tubercle, and medial prefrontal cortex | journal = Brain Research | volume = 520 | issue = 1–2 | pages = 303–9 | date = June 1990 | pmid = 2145054 | doi = 10.1016/0006-8993(90)91719-W | s2cid = 24436917 }} Despite lack of direct serotonin activity, rats treated with subchronic doses of amfonelic acid display subsequent decreases in 5HT and 5HIAA.{{cite journal | vauthors = McMillen BA, Scott SM, Williams HL | title = Effects of subchronic amphetamine or amfonelic acid on rat brain dopaminergic and serotonergic function | journal = Journal of Neural Transmission. General Section | volume = 83 | issue = 1–2 | pages = 55–66 | year = 1991 | pmid = 2018630 | doi = 10.1007/BF01244452 | s2cid = 13008483 }} Amfonelic acid displays no activity in the norepinephrine system.{{cite journal | vauthors = Agmo A, Belzung C, Rodríguez C | title = A rat model of distractibility: effects of drugs modifying dopaminergic, noradrenergic and GABAergic neurotransmission | journal = Journal of Neural Transmission | volume = 104 | issue = 1 | pages = 11–29 | year = 1997 | pmid = 9085190 | doi = 10.1007/BF01271291 | s2cid = 19112365 }}

Despite its different mechanism of action, amfonelic acid displays discriminatory substitution with 150% the stimulant potency of dextroamphetamine.{{cite journal | vauthors = Aceto MD, Rosecrans JA, Young R, Glennon RA | title = Similarity between (+)-amphetamine and amfonelic acid | journal = Pharmacology, Biochemistry, and Behavior | volume = 20 | issue = 4 | pages = 635–7 | date = April 1984 | pmid = 6728880 | doi = 10.1016/0091-3057(84)90316-2 | s2cid = 30259648 }} Amfonelic acid has been shown to be neuroprotective against methamphetamine damage to dopamine neurons.{{cite journal | vauthors = Pu C, Fisher JE, Cappon GD, Vorhees CV | title = The effects of amfonelic acid, a dopamine uptake inhibitor, on methamphetamine-induced dopaminergic terminal degeneration and astrocytic response in rat striatum | journal = Brain Research | volume = 649 | issue = 1–2 | pages = 217–24 | date = June 1994 | pmid = 7953636 | doi = 10.1016/0006-8993(94)91067-7 | s2cid = 23292364 }} It also increases the effects of the antipsychotic drugs haloperidol, trifluoperazine and spiperone.{{cite journal | vauthors = Waldmeier PC, Huber H, Heinrich M, Stoecklin K | title = Discrimination of neuroleptics by means of their interaction with amfonelic acid: an attempt to characterize the test | journal = Biochemical Pharmacology | volume = 34 | issue = 1 | pages = 39–44 | date = January 1985 | pmid = 2857083 | doi = 10.1016/0006-2952(85)90097-8 }} Rats are shown to self-administer amfonelic acid in a dose-dependent manner.{{cite journal | vauthors = Porrino LJ, Goodman NL, Sharpe LG | title = Intravenous self-administration of the indirect dopaminergic agonist amfonelic acid by rats | journal = Pharmacology, Biochemistry, and Behavior | volume = 31 | issue = 3 | pages = 623–6 | date = November 1988 | pmid = 2908003 | doi = 10.1016/0091-3057(88)90240-7 | s2cid = 24551129 | url = https://zenodo.org/record/1258297 }}

Though AFA was discovered in the course of antibiotic research, there is very little data available on the drug's antimicrobial activity. In 1988, the biologist G.C. Crumplin wrote, "[AFA] is less active against bacteria than are many other 4-quinolones, but studies in our laboratory on selected mammalian cell lines have shown it to be markedly more toxic to these cells than are the 4-quinolones that are more active antibacterial agents. Furthermore, it can be shown that sublethal doses induced marked changes in the pattern of proteins produced by the cell, thus suggesting a possible effect of 4-quinolones on gene transcription in mammalian cells."{{cite journal | vauthors = Crumplin GC | title = Aspects of chemistry in the development of the 4-quinolone antibacterial agents | journal = Reviews of Infectious Diseases | volume = 10 Suppl 1 | issue = 10 | pages = S2-9 | year = 1988 | pmid = 3279494 | doi = 10.1093/clinids/10.Supplement_1.S2 }} When evaluated via broth microdilution the MIC of AFA for Escherichia coli is 125 μg/mL, a concentration thirty times higher than the MIC for nalidixic acid in the same E. coli strain.

See also

References

{{Reflist}}