ammonium oxalate

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 457442161

| ImageFile = Ammonium oxalate.svg

| ImageSize = 200px

| IUPACName = Ammonium oxalate

| OtherNames = Diammonium oxalate

| SystematicName = Ammonium ethanedioate

| Section1 = {{Chembox Identifiers

| CASNo = 1113-38-8

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo1 = 6009-70-7

| CASNo1_Ref = {{cascite|correct|CAS}}

| CASNo1_Comment = (monohydrate)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0PB8MO5U0H

| UNII1_Ref = {{fdacite|correct|FDA}}

| UNII1 = L4MP14OB48

| UNII1_Comment = (monohydrate)

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C2H2O4.2H3N/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);2*1H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = VBIXEXWLHSRNKB-UHFFFAOYSA-N

| PubChem = 14213

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 13577

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 91241

| SMILES = [O-]C(=O)C([O-])=O.[NH4+].[NH4+]

| InChI = InChI=1S/C2H2O4.2H3N/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);2*1H3

}}

| Section2 = {{Chembox Properties

| Formula = {{chem2|[NH4]2C2O4}}

| C=2|H=8|N=2|O=4

| Appearance = Colorless or white crystalline solid

| Density = 1.5 g/cm³{{cite book |author1=John Rumble |title=CRC Handbook of Chemistry and Physics |date=June 18, 2018 |publisher=CRC Press |isbn=978-1138561632 |pages=4–41|edition=99th |language=English}}

| MeltingPt = 70 C (158 F, 343.15 K)

| BoilingPt =

| Solubility = 5.20 g/(100 ml) (25 °C)

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

| Section7 = {{Chembox Hazards

| ExternalSDS =

| MainHazards =

| GHSPictograms =

| GHSSignalWord =

| HPhrases = {{H-phrases|302|312|319}}

}}

}}

Ammonium oxalate is a chemical compound with the chemical formula {{chem2|[NH4]2C2O4|auto=1}}. Its formula is often written as {{chem2|(NH4)2C2O4}} or {{chem2|(COONH4)2}}. It is an ammonium salt of oxalic acid. It consists of ammonium cations ({{chem2|[NH4]+}}) and oxalate anions ({{chem2|C2O4(2−)}}). The structure of ammonium oxalate is {{chem2|([NH4]+)2[C2O4](2−)}}. Ammonium oxalate sometimes comes as a monohydrate ({{chem2|[NH4]2C2O4*H2O}}). It is a colorless or white salt under standard conditions and is odorless and non-volatile. It occurs in many plants and vegetables.