ammonium succinate
{{Chembox
| Name = Ammonium succinate
| ImageFile = Ammonium succinate.svg
| ImageSize =
| ImageAlt =
| IUPACName = diazanium;butanedioate
| OtherNames = Diammonium succinate
| Section1 = {{Chembox Identifiers
| CASNo = 2226-88-2
| CASNo_Ref = {{Cascite|correct|CAS}}
| ChemSpiderID = 141144
| DTXSID = DTXCID3036652
| EC_number = 218-759-3
| UNII = DTZ9PEC9JL
| PubChem = 14093702
| InChI = InChI=1S/C4H6O4.2H3N/c5-3(6)1-2-4(7)8;;/h1-2H2,(H,5,6)(H,7,8);2*1H3
| InChIKey = NHJPVZLSLOHJDM-UHFFFAOYSA-N
| SMILES = C(CC(=O)O)C(=O)O.N.N
}}
| Section2 = {{Chembox Properties
| N=2|H=12|O=4|C=4
| MolarMass =
| Appearance = colorless crystals
| Density = 1.601 g/cm3
| MeltingPt =
| BoilingPt = 236.1 °C
| Solubility = soluble
}}
| Section3 = {{Chembox Hazards
| GHSPictograms = {{GHS07}}
| GHSSignalWord = Warning
| GHS_ref = {{cite web |title=Ammonium succinate |url=https://www.sigmaaldrich.com/RU/en/product/ambeedinc/ambh93e4c9e2?context=bbe |publisher=Sigma Aldrich |access-date=5 March 2025}}
| HPhrases = {{H-phrases|315|319}}
| PPhrases = {{P-phrases|261|280|302|352|305|351|338}}
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Ammonium succinate is a chemical compound with the chemical formula {{chem2|C4H4O4(NH4)2}}.{{cite web |title=Ammonium succinate {{!}} CAS 15574-09-1 {{!}} SCBT - Santa Cruz Biotechnology |url=https://www.scbt.com/p/ammonium-succinate-15574-09-1 |publisher=scbt.com |access-date=5 March 2025 |language=en}} This is an organic ammonium salt of succinic acid.
Synthesis
Succinic acid reacts with ammonium carbonate to form ammonium succinate.
Also, a reaction of ammonia water with succinic acid:{{cite book |last1=Lloyd |first1=John Uri |title=The Chemistry of Medicines, Practical: A Text and Reference Book for the Use of Students, Physicians, and Pharmacists, Embodying the Principles of Chemical Philosophy and Their Application to Those Chemicals that are Used in Medicine ... |date=1883 |publisher=R. Clarke |page=216 |url=https://books.google.com/books?id=6Vs3AAAAMAAJ&dq=Ammonium+succinate&pg=PA216 |access-date=5 March 2025 |language=en}}{{cite book |last1=Muter |first1=John |title=An Introduction to pharmaceutical and medical chemistry |date=1880 |publisher=W. Bater |page=269 |url=https://books.google.com/books?id=T_VbQ-IrQDQC&dq=Ammonium+succinate&pg=PA269 |access-date=5 March 2025 |language=en}}
::{{chem2|2NH4OH + H2C4H4O4 -> C4H4O4(NH4)2 + 2H2O}}
Physical properties
Ammonium succinate forms colorless crystals, easily soluble in water.
Thermal decomposition of ammonium succinate produces succinimide.{{cite journal |title=SUCCINIMIDE |journal=Organic Syntheses |date=1936 |volume=16 |pages=75 |doi=10.15227/orgsyn.016.0075 |url=https://orgsyn.org/demo.aspx?prep=CV2P0562 |access-date=6 March 2025 |language=en}}
Uses
The compound is used a mediator in medicine, lacquer manufacture, and in the production of perfume esters. It is also used in food as a sequestrant, buffer, and neutralizing agent.{{cite web |title=MeSH Browser |url=https://meshb.nlm.nih.gov/record/ui?ui=D019802 |publisher=meshb.nlm.nih.gov |access-date=6 March 2025}}