amonafide

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 443275125

| IUPAC_name = 5-amino-2-[2-(dimethylamino)ethyl]-1H-benzo[de]isoquinoline-1,3(2H)-dione

| image = Amonafide.svg

| tradename = Xanafide, Quinamed

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 69408-81-7

| ATC_prefix = none

| ATC_suffix =

| PubChem = 50515

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 45804

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 1Q8D39N37L

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 428676

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D10090

| C=16 | H=17 | N=3 | O=3

| smiles = O=C2c1c3c(ccc1)cc(cc3C(=O)N2CCN(C)C)N

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H17N3O2/c1-18(2)6-7-19-15(20)12-5-3-4-10-8-11(17)9-13(14(10)12)16(19)21/h3-5,8-9H,6-7,17H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = UPALIKSFLSVKIS-UHFFFAOYSA-N

}}

Amonafide (originally AS1413) (INN, trade names Quinamed and Xanafide) was a drug that was being studied in the treatment of cancer. It belongs to a novel family of chemotherapeutic drugs called Naphthalimides and is a potential topoisomerase inhibitor and DNA intercalator.{{cite journal | vauthors = Allen SL, Lundberg AS | title = Amonafide: a potential role in treating acute myeloid leukemia | journal = Expert Opinion on Investigational Drugs | volume = 20 | issue = 7 | pages = 995–1003 | date = July 2011 | pmid = 21591994 | doi = 10.1517/13543784.2011.585756 | s2cid = 10999582 }}{{cite journal | vauthors = Freeman CL, Swords R, Giles FJ | title = Amonafide: a future in treatment of resistant and secondary acute myeloid leukemia? | journal = Expert Review of Hematology | volume = 5 | issue = 1 | pages = 17–26 | date = February 2012 | pmid = 22272701 | doi = 10.1586/ehm.11.68 | s2cid = 26740617 }}

It was being developed as an anti-cancer therapy by Antisoma.{{cite web | title = Antisoma's Shares Plummet 70% as Cancer Candidate Bombs in Phase III NSCLC Trial | url = http://www.genengnews.com/news/bnitem.aspx?name=78979622 | archive-url = https://web.archive.org/web/20100401235144/http://www.genengnews.com/news/bnitem.aspx?name=78979622 | archive-date = 1 April 2010 | date = 29 March 2010 | work = Genetic Engineering & Biotechnology News }}

{{As of|2008}}, it is in Phase III clinical trials.

e.g. In March 2010 it is Phase III trial against secondary acute myeloid leukaemia (AML).{{ClinicalTrialsGov|NCT00715637|Phase III Randomized Study of Amonafide (AS1413) and Cytarabine Versus Daunorubicin and Cytarabine in Patients With Secondary Acute Myeloid Leukemia (AML)- the ACCEDE Study}} In June 2010, it gained an FDA Fast Track Status for the treatment of Secondary Acute Myeloid Leukaemia.{{cn|date=February 2023}}