anagliptin

{{short description|Chemical compound}}

{{Drugbox

| drug_name =

| IUPAC_name = N-[2-[[2-[(2S)-2-Cyanopyrrolidin-1-yl]-2-oxoethyl]amino]-2-methylpropyl]-2-methylpyrazolo[1,5-a]pyrimidine-6-carboxamide

| image = Anagliptin.svg

| alt =

| caption =

| tradename = Suiny

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Approved in Japan

| routes_of_administration = Oral

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 739366-20-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = K726J96838

| ATCvet =

| ATC_prefix = none

| ATC_suffix =

| PubChem =

| DrugBank =

| ChemSpiderID = 28492667

| C=19 | H=25 | N=7 | O=2

| smiles = CC1=NN2C=C(C=NC2=C1)C(=O)NCC(C)(C)NCC(=O)N3CCC[C@H]3C#N

| StdInChI=1S/C19H25N7O2/c1-13-7-16-21-9-14(11-26(16)24-13)18(28)22-12-19(2,3)23-10-17(27)25-6-4-5-15(25)8-20/h7,9,11,15,23H,4-6,10,12H2,1-3H3,(H,22,28)/t15-/m0/s1

| StdInChIKey= LDXYBEHACFJIEL-HNNXBMFYSA-N

}}

Anagliptin (INN; trade name Suiny) is a pharmaceutical drug for the treatment of type 2 diabetes mellitus. It is approved for use in Japan.{{cite journal | vauthors = Graul AI, Lupone B, Cruces E, Stringer M | title = 2012 in review - part I: the year's new drugs & biologics | journal = Drugs of Today | volume = 49 | issue = 1 | pages = 33–68 | date = January 2013 | pmid = 23362494 | doi = 10.1358/dot.2013.49.1.1933991 | url = http://thomsonreuters.com/business-unit/science/pdf/ls/years_new_drugs_biologics-2012.pdf | url-status = dead | archive-url = https://web.archive.org/web/20131103135328/http://thomsonreuters.com/business-unit/science/pdf/ls/years_new_drugs_biologics-2012.pdf | archive-date = 2013-11-03 }} It belongs to the class of anti-diabetic drugs known as dipeptidyl peptidase-4 inhibitors or "gliptins".{{cite journal | vauthors = Kato N, Oka M, Murase T, Yoshida M, Sakairi M, Yamashita S, Yasuda Y, Yoshikawa A, Hayashi Y, Makino M, Takeda M, Mirensha Y, Kakigami T | display-authors = 6 | title = Discovery and pharmacological characterization of N-[2-({2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl}amino)-2-methylpropyl]-2-methylpyrazolo[1,5-a]pyrimidine-6-carboxamide hydrochloride (anagliptin hydrochloride salt) as a potent and selective DPP-IV inhibitor | journal = Bioorganic & Medicinal Chemistry | volume = 19 | issue = 23 | pages = 7221–7 | date = December 2011 | pmid = 22019046 | doi = 10.1016/j.bmc.2011.09.043 }}