anilazine

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 413866277

|ImageFile=Anilazine.png

|ImageSize=200px

|ImageFile2=Anilazine-3D-balls.png

|PIN=4,6-Dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine

|OtherNames= Anilazine (Dyrene);

dyrene

|Section1= {{Chembox Identifiers

| InChIKey = IMHBYKMAHXWHRP-UHFFFAOYAQ

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 7260

| InChI = 1/C9H5Cl3N4/c10-5-3-1-2-4-6(5)13-9-15-7(11)14-8(12)16-9/h1-4H,(H,13,14,15,16)

| SMILES=Clc1nc(nc(Cl)n1)Nc2ccccc2Cl

| MeSHName=

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C9H5Cl3N4/c10-5-3-1-2-4-6(5)13-9-15-7(11)14-8(12)16-9/h1-4H,(H,13,14,15,16)

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 464135

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = IMHBYKMAHXWHRP-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 101-05-3

| PubChem = 7541

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = C6E8Y03ZJN

| UNNumber = 3077, 2588

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = C18935

| RTECS = XY7175000

| EINECS = 202-910-5

}}

|Section2= {{Chembox Properties

| C=9

| H=5

| Cl=3

| N=4

| Appearance=White to light brown crystals or powder

| Density= 1.611 g/cm³

| MeltingPtC = 159

| BoilingPtC = 365

| Solubility= 0.0008 g/100mL

| SolubleOther = hexane: .017 g/100 mL
methylene chloride: 9 g/100 mL
acetone: 10 g/100 mL
chlorobenzene: 6 g/100 mL
toluene: 5 g/100 mL
xylene: 4 g/100 mL

| VaporPressure = 2.48x10⁻⁵ mmHg

}}

|Section3= {{Chembox Hazards

| FlashPtC = 232.2

| GHSSignalWord = Danger

| GHSPictograms = {{GHS05}}{{GHS07}}{{GHS09}}

| HPhrases = {{H-phrases|315|318|319|410}}

| PPhrases = {{P-phrases|264|273|280|302+352|305+351+338|310|321|332+313|337+313|362|391|501}}

| LD50 = >5,000 mg/kg

}}

}}

Anilazine (ǎ-nǐl-a-zēn) is an organic compound with the chemical formula C₉H₅Cl₃N₄. It is a pesticide used on crops. It comes under the category of triazine fungicides. It is used for controlling fungus diseases which attack lawns and turf, cereals, coffee, and a wide variety of vegetables and other crops. It is also used for the control of potato and tomato leafspots.