anilazine

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 413866277

|ImageFile=Anilazine.png

|ImageSize=200px

|ImageFile2=Anilazine-3D-balls.png

|PIN=4,6-Dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine

|OtherNames= Anilazine (Dyrene);

dyrene

|Section1= {{Chembox Identifiers

| InChIKey = IMHBYKMAHXWHRP-UHFFFAOYAQ

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 7260

| InChI = 1/C9H5Cl3N4/c10-5-3-1-2-4-6(5)13-9-15-7(11)14-8(12)16-9/h1-4H,(H,13,14,15,16)

| SMILES=Clc1nc(nc(Cl)n1)Nc2ccccc2Cl

| MeSHName=

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C9H5Cl3N4/c10-5-3-1-2-4-6(5)13-9-15-7(11)14-8(12)16-9/h1-4H,(H,13,14,15,16)

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 464135

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = IMHBYKMAHXWHRP-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 101-05-3

| PubChem = 7541

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = C6E8Y03ZJN

| UNNumber = 3077, 2588

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = C18935

| RTECS = XY7175000

| EINECS = 202-910-5

}}

|Section2= {{Chembox Properties

| C=9

| H=5

| Cl=3

| N=4

| Appearance=White to light brown crystals or powder

| Density= 1.611 g/cm3

| MeltingPtC = 159

| BoilingPtC = 365

| Solubility= 0.0008 g/100mL

| SolubleOther = hexane: .017 g/100 mL
methylene chloride: 9 g/100 mL
acetone: 10 g/100 mL
chlorobenzene: 6 g/100 mL
toluene: 5 g/100 mL
xylene: 4 g/100 mL

| VaporPressure = 2.48x10−5 mmHg

}}

|Section3= {{Chembox Hazards

| FlashPtC = 232.2

| GHSSignalWord = Danger

| GHSPictograms = {{GHS05}}{{GHS07}}{{GHS09}}

| HPhrases = {{H-phrases|315|318|319|410}}

| PPhrases = {{P-phrases|264|273|280|302+352|305+351+338|310|321|332+313|337+313|362|391|501}}

| LD50 = >5,000 mg/kg

}}

}}

Anilazine (ǎ-nǐl-a-zēn) is an organic compound with the chemical formula C9H5Cl3N4. It is a pesticide used on crops. It comes under the category of triazine fungicides. It is used for controlling fungus diseases which attack lawns and turf, cereals, coffee, and a wide variety of vegetables and other crops. It is also used for the control of potato and tomato leafspots.

Toxicity

Oral administration to rats and cats, the most common signs of toxicity were diarrhea and vomiting respectively After dermal administration to rabbits mild skin irritation manifested as edema and erythema was observed. Anilazine was more toxic by intraperitoneal injection than by other routes of administration.[http://www.inchem.org/documents/jmpr/jmpmono/v89pr02.htm IPCS InChem document]

Medical use

In 1955, Bergsmann studied dairin as a tuberculocide.{{cite journal |pmid=13253229|year=1955|author1=BERGSMANN O|title=A report on the clinical application of dairin, a tuberculocide|journal=Die Medizinische|issue=29–30|pages=1053–5}}

References

{{reflist}}